Vandrikidine

Catalog Number	ACM50656923
CAS Number	50656-92-3
Molecular Weight	382.5
InChI	InChI=1S/C22H26N2O4/c1-13(25)21-7-4-9-24-10-8-22(20(21)24)16-6-5-14(27-2)11-17(16)23-18(22)15(12-21)19(26)28-3/h4-7,11,13,20,23,25H,8-10,12H2,1-3H3/t13-,20+,21+,22+/m1/s1
InChI Key	ASAFZNAXYPDIJR-MCLJMYSDSA-N
Purity	95%+
Complexity	749
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	382.18925731
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@H]([C@]12CC(=C3[C@@]4([C@H]1N(CC4)CC=C2)C5=C(N3)C=C(C=C5)OC)C(=O)OC)O
Monoisotopic Mass	382.18925731
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	71 Ų

Custom Q&A

What is the chemical formula of Vandrikidine?

The chemical formula of Vandrikidine is C22H26N2O4.

What is the molecular weight of Vandrikidine?

The molecular weight of Vandrikidine is 382.46 g/mol.

What is the boiling point of Vandrikidine?

The predicted boiling point of Vandrikidine is 536.2 ± 50.0 °C.

What is the density of Vandrikidine?

The predicted density of Vandrikidine is 1.34 ± 0.1 g/cm3.

What is the pka value of Vandrikidine?

The predicted pka value of Vandrikidine is 14.75 ± 0.20.

In what types of species is Vandrikidine found?

Vandrikidine is found in a number of Aspidosperma species.

What is Vandrikidine isomeric with?

Vandrikidine is isomeric with vandrikine.

How was the structure of Vandrikidine elucidated?

The structure of Vandrikidine was elucidated from spectroscopic evidence.

What is the synthesis of Vandrikidine based on?

The synthesis of Vandrikidine is based on references like Wenkert et al., J. Amer. Chem. Soc., 95, 4990 (1973).

※ Please kindly note that our products are for research use only.