Vasicinone

Catalog Number	ACM486646-1
CAS Number	486-64-6
Description	Bronchodilatory, anti-tubercular and cytotoxic activity
Molecular Weight	202.21 g/mol
Molecular Formula	C11H10N2O2
Canonical SMILES	C1CN2C(=NC3=CC=CC=C3C2=O)[C@H]1O

Custom Q&A

What is the chemical formula of Vasicinone?

The chemical formula of Vasicinone is C11H10N2O2.

What is the molecular weight of Vasicinone?

The molecular weight of Vasicinone is 202.21 g/mol.

What is the melting point of Vasicinone?

The melting point of Vasicinone is 200-202°C.

In what solvents is Vasicinone soluble?

Vasicinone is soluble in chloroform and ethanol.

What is the refractive index of Vasicinone?

The refractive index of Vasicinone is estimated to be 1.5300.

What is a common source of Vasicinone?

Vasicinone is found in Adhatoda vasica and Peganum harmala.

What are some of the salts that can be formed with Vasicinone?

Vasicinone can form salts like hydrochloride, hydrobromide, hydriodide, nitrate, and sulfate.

What is the optical activity of the synthetic form of Vasicinone?

The optically inactive form of Vasicinone has been prepared synthetically with a melting point of 211-212°C.

What is the main activity of Vasicinone?

Vasicinone is known to be an active bronchodilator.

What is the target enzyme of Vasicinone according to the reference?

The target enzyme of Vasicinone is P450, specifically CYP17.

※ Please kindly note that our products are for research use only.