Velutinam

Catalog Number	ACM146428628
CAS Number	146428-62-8
Molecular Weight	295.29
InChI	InChI=1S/C17H13NO4/c1-21-13-7-10-14-11(18-17(10)20)6-9-8(4-3-5-12(9)19)15(14)16(13)22-2/h3-7,19H,1-2H3,(H,18,20)
InChI Key	KUZNZVMKXPBYIB-UHFFFAOYSA-N
Purity	95%+
Complexity	456
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	295.0844579
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	295.0844579
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	67.8 Ų

Custom Q&A

What is the chemical formula of Velutinam?

The chemical formula of Velutinam is C17H13NO4.

What is the molecular weight of Velutinam?

The molecular weight of Velutinam is 295.29.

What is the CAS number of Velutinam?

The CAS number of Velutinam is 146428-62-8.

What is the melting point of Velutinam?

The melting point of Velutinam is 268-269 °C.

What is the predicted boiling point of Velutinam?

The predicted boiling point of Velutinam is 485.6±45.0 °C.

What is the predicted density of Velutinam?

The predicted density of Velutinam is 1.419±0.06 g/cm3.

What is the predicted pKa value of Velutinam?

The predicted pKa value of Velutinam is 9.28±0.20.

What are some synonyms of Velutinam?

One synonym of Velutinam is Dibenz[cd,f]indol-4(5H)-one, 7-hydroxy-1,2-dimethoxy-.

※ Please kindly note that our products are for research use only.