Veratrosine

Catalog Number	ACM475003-1
CAS Number	475-00-3
Synonyms	3-O-beta-D-Glucopyranosylveratramine
Molecular Weight	571.7
InChI	InChI=1S/C33H49NO7/c1-16-11-26(36)28(34-14-16)18(3)21-7-8-22-23-6-5-19-12-20(9-10-33(19,4)25(23)13-24(22)17(21)2)40-32-31(39)30(38)29(37)27(15-35)41-32/h5,7-8,16,18,20,23,25-32,34-39H,6,9-15H2,1-4H3/t16-,18-,20-,23-,25-,26+,27+,28-,29+,30-,31+,32+,33-/m0/s1
InChI Key	WXQHVBNTINGJJR-NIFRNHPISA-N
Melting Point	237.8-239.7 °C
Purity	95%+
Complexity	962
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	13
Exact Mass	571.3509029
Heavy Atom Count	41
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	6
Isomeric SMILES	C[C@H]1C[C@H]([C@@H](NC1)[C@@H](C)C2=C(C3=C(C=C2)[C@@H]4CC=C5C[C@H](CC[C@@]5([C@H]4C3)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)O
Monoisotopic Mass	571.3509029
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	132 Ų

Custom Q&A

What is another name for Veratrosine?

Veratramine 3-glucoside

What is the chemical formula for Veratrosine?

C33H49NO7

What is the molecular weight of Veratrosine?

571.74

What is the solubility of Veratrosine in DMSO?

Soluble

What is the melting point of Veratrosine in methanol?

237.8-239.7℃

What is the boiling point of Veratrosine?

740.7±60.0 °C (Predicted)

What is the form of Veratrosine?

A solid

What is the pka value of Veratrosine?

12.91±0.70 (Predicted)

Where can Veratrosine be found in nature?

Veratrum viride

What biological activities has Veratrosine displayed?

Antitumor and anti-platelet activity, inhibiting the hedgehog pathway.

※ Please kindly note that our products are for research use only.