Vinblastine sulfate

Catalog Number	ACM143679-2
CAS Number	143-67-9
Structure
Synonyms	Velban
IUPAC Name	Methyl (1R,9R,10S,11R,12R,19R)-11-acetyloxy-12-ethyl-4-[(13S,15R,17S)-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl]-10-hydroxy-5-methoxy-8-methyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate;sulfuric acid
Molecular Weight	909.05
Molecular Formula	C46H60N4O13S
Canonical SMILES	CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
InChI	InChI=1S/C46H58N4O9.H2O4S/c1-8-42(54)23-28-24-45(40(52)57-6,36-30(15-19-49(25-28)26-42)29-13-10-11-14-33(29)47-36)32-21-31-34(22-35(32)56-5)48(4)38-44(31)17-20-50-18-12-16-43(9-2,37(44)50)39(59-27(3)51)46(38,55)41(53)58-7;1-5(2,3)4/h10-14,16,21-22,28,37-39,47,54-55H,8-9,15,17-20,23-26H2,1-7H3;(H2,1,2,3,4)/t28-,37-,38+,39+,42-,43+,44+,45-,46-;/m0./s1
InChI Key	KDQAABAKXDWYSZ-PNYVAJAMSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	1780
Exact Mass	908.38775915
Heavy Atom Count	64
Isomeric SMILES	CC[C@@]1(C[C@H]2C[C@@](C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)[C@]78CCN9[C@H]7[C@@](C=CC9)([C@H]([C@@]([C@@H]8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
Monoisotopic Mass	908.38775915
Topological Polar Surface Area	237Ų

Custom Q&A

What is the molecular formula of Vinblastine sulfate?

The molecular formula of Vinblastine sulfate is C46H60N4O13S.

What is the solubility of Vinblastine sulfate in water?

Vinblastine sulfate is soluble in water at a concentration of 10 mg/mL.

What is the melting point of Vinblastine sulfate?

The melting point of Vinblastine sulfate is 267°C (dec.)(lit.).

What are some synonyms of Vinblastine sulfate?

Some synonyms of Vinblastine sulfate include velban, velbe, and vincaleukoblastine sulfate.

What is the primary therapeutic function of Vinblastine sulfate?

The primary therapeutic function of Vinblastine sulfate is cancer chemotherapy.

How does Vinblastine sulfate affect cells in vitro?

Vinblastine sulfate arrests growing cells in metaphase when treated in vitro.

What are some uses of Vinblastine sulfate in cancer treatment?

Vinblastine sulfate is used in the treatment of Hodgkin disease, choriocarcinoma, acute and chronic leukemias, and various other types of cancer.

What are some potential drug interactions with Vinblastine sulfate?

Potential drug interactions with Vinblastine sulfate include phenytoin levels reduction with antiepileptics and increased toxicity with antibacterials like erythromycin.

What are the side effects associated with Vinblastine sulfate exposure?

Side effects of exposure to Vinblastine sulfate may include mental depression, loss of deep-tendon reflexes, headache, convulsions, and gastrointestinal issues like constipation and nausea.

How is Vinblastine sulfate metabolized in the body?

Vinblastine sulfate is extensively metabolized in the liver by the CYP3A group of isoenzymes to desacetylvinblastine, which is more active than the parent compound.

※ Please kindly note that our products are for research use only.