Vincosamide

Catalog Number	ACM23141277
CAS Number	23141-27-7
Structure
Synonyms	(1R)-1β-Ethenyl-2α-(β-D-glucopyranosyloxy)-1,2,7,8,13,13bα,14,14aα-octahydro-5H-indolo[2,3-a]pyrano[3,4-g]quinolizine-5-one
Molecular Weight	498.5
InChI	InChI=1S/C26H30N2O8/c1-2-12-15-9-18-20-14(13-5-3-4-6-17(13)27-20)7-8-28(18)24(33)16(15)11-34-25(12)36-26-23(32)22(31)21(30)19(10-29)35-26/h2-6,11-12,15,18-19,21-23,25-27,29-32H,1,7-10H2/t12-,15+,18-,19-,21-,22+,23-,25+,26+/m1/s1
InChI Key	LBRPLJCNRZUXLS-AZVRXDBZSA-N
Purity	95%+
Complexity	899
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	9
Exact Mass	498.20021592
Heavy Atom Count	36
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	5
Isomeric SMILES	C=C[C@@H]1[C@@H]2C[C@@H]3C4=C(CCN3C(=O)C2=CO[C@H]1O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=CC=CC=C6N4
Monoisotopic Mass	498.20021592
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	145 Ų

Custom Q&A

What is the chemical name of Vincosamide?

The chemical name of Vincosamide is (1R)-1β-Ethenyl-2α-(β-D-glucopyranosyloxy)-1,2,7,8,13,13bα,14,14aα-octahydro-5H-indolo[2,3-a]pyrano[3,4-g]quinolizine-5-one.

What are some synonyms of Vincosamide?

Some synonyms of Vincosamide include Vincoside lactam, Camptoside, and (3β,15β)-19,20-Didehydro-16α-ethenyl-17β-(β-D-glucopyranosyloxy)-18-oxayohimban-21-one.

What is the CAS number for Vincosamide?

The CAS number for Vincosamide is 23141-27-7.

What is the molecular formula of Vincosamide?

The molecular formula of Vincosamide is C26H30N2O8.

What is the molecular weight of Vincosamide?

The molecular weight of Vincosamide is 498.52.

What is the storage temperature recommended for Vincosamide?

The storage temperature recommended for Vincosamide is -20°C.

How is Vincosamide classified in terms of water solubility?

Vincosamide is classified as WGK Germany 3 in terms of water solubility.

How is Vincosamide used in the industry?

Vincosamide is used as a monoterpenoid indole alkaloid.

What are some other names for Vincosamide in the industry?

Vincosamide is also known as Oxayohimban-21-one,19,20-didehydro-16-ethenyl-17-(β-D-glucopyranosyloxy)-, (3β,15β,16α,17β)- and (3β,15β,16α,17β)-21-Oxo-16-vinyl-19,20-didehydro-18-oxayohimban-17-ylβ-D-glucopyranoside.

What is the purity of Vincosamide provided as per LC/MS-ELSD analysis?

Vincosamide is provided with a purity of >=90% as per LC/MS-ELSD analysis.

※ Please kindly note that our products are for research use only.