Vindesine sulfate

Catalog Number	ACM59917394
CAS Number	59917-39-4
Structure
Description	Microtubule disrupter; anti-mitotic drug; anti-cancer alkaloid
Synonyms	LY-099094EldisineFildesin
Molecular Weight	852.01 g/mol
Molecular Formula	C43H57N5O11S
Canonical SMILES	CC[C@@]1(C[C@@H]2C[C@@](C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)[C@]78CCN9[C@H]7[C@@](C=CC9)([C@H]([C@@]([C@@H]8N6C)(C(=O)N)O)O)CC)OC)C(=O)OC)O.OS(=O)(=O)O
Storage	store at <-15℃, close container well
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939799090 - China: 2939799099
MDL Number	MFCD01675266

Custom Q&A

What is the synonym for Vindesine sulfate listed in the reference?

Desacetylvinblastine amide sulfate salt; Fildesi; LY-099094; VINCRISITINESULFATE; Vincaleukoblastine

What is the molecular formula of Vindesine sulfate?

C43H57N5O11S

What is the molecular weight of Vindesine sulfate?

852

At what temperature does Vindesine sulfate melt?

>250°C

What is the color of Vindesine sulfate in its powder form?

Off-white to light yellow

What is the solubility of Vindesine sulfate in deionized water?

≥50mg/mL

What is the main usage of Vindesine sulfate?

Anticancer

What is the brand name for Vindesine sulfate?

Eldisine (Lilly)

What is the hazard class of Vindesine sulfate?

6.1(a)

What is the LD50 toxicity value of Vindesine sulfate in mice and rats?

6.3 ± 0.6 mg/kg in mice, 2.0 ± 0.2 mg/kg in rats.

※ Please kindly note that our products are for research use only.