Vineridine

Catalog Number	ACM3489063-1
CAS Number	3489-06-3
Structure
Synonyms	Isocaboxine A
Molecular Weight	398.5
InChI	InChI=1S/C22H26N2O5/c1-12-15-10-24-7-6-22(17-5-4-13(27-2)8-18(17)23-21(22)26)19(24)9-14(15)16(11-29-12)20(25)28-3/h4-5,8,11-12,14-15,19H,6-7,9-10H2,1-3H3,(H,23,26)/t12-,14-,15-,19+,22-/m0/s1
InChI Key	SRKHGHLMEDVZRX-PNGOUSOWSA-N
Purity	95%+
Complexity	739
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	398.18417193
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1[C@@H]2CN3CC[C@@]4([C@H]3C[C@@H]2C(=CO1)C(=O)OC)C5=C(C=C(C=C5)OC)NC4=O
Monoisotopic Mass	398.18417193
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	77.1 Ų

Custom Q&A

What is the chemical name of Vineridine?

The chemical name of Vineridine is (3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester.

What are some synonyms of Vineridine?

Some synonyms of Vineridine include Isocaboxine A and IsoCarboxine A.

What is the CAS number of Vineridine?

The CAS number of Vineridine is 3489-06-3.

What is the molecular formula of Vineridine?

The molecular formula of Vineridine is C22H26N2O5.

What is the molecular weight of Vineridine?

The molecular weight of Vineridine is 398.45.

What is the melting point of Vineridine?

The melting point of Vineridine is between 130-188°C.

From which plant is Vineridine derived?

Vineridine is derived from the stem, stem bark, root, and root bark of Cabucala fasciculata.

How is Vineridine separated from other alkaloids?

Vineridine is separated from other alkaloids using column chromatography.

What is the specific rotation of Isocarboxine A, a form of Vineridine?

The specific rotation of Isocarboxine A is [α]D +31.7° (CHCl3).

What is a reference for the investigation of the alkaloids found in Cabucala fasciculata?

Titeux, Le Men-Olivier, LeMen, Phytochem., 14,565 (1975) is a reference for the investigation of the alkaloids found in Cabucala fasciculata.

※ Please kindly note that our products are for research use only.