Vinflunine ditartrate

Vinflunine ditartrate

Inquiry
Catalog Number ACM194468365-1
CAS Number 194468-36-5
Structure
Description Vinflunine is a cytotoxic drug that inhibits the polymerization of actin and prevents cell division. It binds to the terminal amino group of lysine residues on the side chain of actin monomers, preventing polymerization and thus inhibiting cell division. Vinflunine has been shown to be effective against solid tumours such as prostate cancer cells or bladder cancer cells, which are resistant to chemotherapy. Vinflunine also has an antineoplastic effect by inhibiting the proliferation of cancer cells. There are two forms of vinflunine: a ditartrate salt (vinflunine ditartrate) and a hydrogen fluoride salt (vinflunine hydrogen fluoride). The molecular weight of vinflunine ditartrate is 477.6 g/mol and its IUPAC name is 2-[(2H-1,2-benzothiazol-3(2H)-on-5-yl
Synonyms 4'-Deoxy-20',20'-difluoro-5'-norvincaleukoblastine ditartrate20',20'-Difluoro-3',4'-dihydrovinorelbine ditartrateBMS 710485
Molecular Weight 1,117.1 g/mol
Molecular Formula C53H66F2N4O20
Canonical SMILES CC[C@@]12C=CCN3[C@@H]1[C@]4(CC3)[C@H]([C@]([C@@H]2OC(=O)C)(C(=O)OC)O)N(C5=CC(=C(C=C45)[C@]6(C[C@H]7C[C@H](CN(C7)CC8=C6NC9=CC=CC=C89)C(C)(F)F)C(=O)OC)OC)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O
Storage store at <-15℃
Harmonized Tariff Code Switzerland: 29181390 - USA: 2918135000 - Slovakia: 2918130000 - UK: 2918130000 - China: 2918130000
MDL Number MFCD12756258
Custom Q&A

What is the chemical name of Vinflunine Ditartrate?

The chemical name of Vinflunine Ditartrate is 20',20'-Difluoro-3',4'-dihydrovinorelbine Ditartrate.

What is the CAS number for Vinflunine Ditartrate?

The CAS number for Vinflunine Ditartrate is 194468-36-5.

What is the molecular formula of Vinflunine Ditartrate?

The molecular formula of Vinflunine Ditartrate is C49H59F2N4O14.

What is the molecular weight of Vinflunine Ditartrate?

The molecular weight of Vinflunine Ditartrate is 966.0079664.

What is the melting point of Vinflunine Ditartrate?

The melting point of Vinflunine Ditartrate is 244-246°C.

How is Vinflunine Ditartrate stored?

Vinflunine Ditartrate is stored at -20°C in a freezer.

What is the primary use of Vinflunine Ditartrate?

Vinflunine Ditartrate is used as an antineoplastic, specifically in the treatment of non-small cell lung cancer, metastatic breast cancer, and ovarian cancer.

What is the mechanism of action of Vinflunine?

Vinflunine is a tubulin polymerization inhibitor with microtubule destabilizing and antiangiogenic activity.

How was Vinflunine Ditartrate synthesized?

Vinflunine Ditartrate can be prepared directly from vinorelbine through the use of superacid chemistry or by synthesizing from vinblastine or 3',4'-dihydrovinblastine.

Who discovered Vinflunine Ditartrate and who currently holds the rights for its development and commercialization?

Vinflunine Ditartrate was discovered by Pierre Fabre Laboratories and the rights were returned to Pierre Fabre after being licensed to Bristol-Myers Squibb for development and commercialization.

※ Please kindly note that our products are for research use only.