Vinpocetine

Catalog Number	ACM42971095
CAS Number	42971-09-5
Structure
Synonyms	Apovincaminic acid ethyl ester
Molecular Weight	350.5
InChI	InChI=1S/C22H26N2O2/c1-3-22-11-7-12-23-13-10-16-15-8-5-6-9-17(15)24(19(16)20(22)23)18(14-22)21(25)26-4-2/h5-6,8-9,14,20H,3-4,7,10-13H2,1-2H3/t20-,22+/m1/s1
InChI Key	DDNCQMVWWZOMLN-IRLDBZIGSA-N
Melting Point	147-153 °C
Purity	98%+
Complexity	617
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	350.199428076
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC[C@@]12CCCN3[C@@H]1C4=C(CC3)C5=CC=CC=C5N4C(=C2)C(=O)OCC
Monoisotopic Mass	350.199428076
PhysicalState	Solid
Rotatable Bond Count	4
Topological Polar Surface Area	34.5 Ų

Custom Q&A

What is the chemical formula of Vinpocetine?

The chemical formula of Vinpocetine is C22H26N2O2.

What are the synonyms of Vinpocetine?

The synonyms of Vinpocetine include CAVINTON, ETHYL APOVINCAMIN-22-OATE, EBURNAMENINE, and RGH-4405.

What are the medicinal properties of Vinpocetine?

Vinpocetine is a cerebrovascular expansion drug that can increase cerebral blood flow, enhance brain oxygen supply, reduce blood viscosity, inhibit platelet aggregation, and promote tissue metabolism.

What is the main application of Vinpocetine?

Vinpocetine is mainly used in the treatment of cerebral infarction sequela, cerebral hemorrhage sequelae, and cerebral arteriosclerosis.

What are the potential side effects of Vinpocetine?

The potential side effects of Vinpocetine include dizziness, tiredness, digestive issues, blood pressure changes, and allergic reactions like skin rash.

What is the chemical property of Vinpocetine?

Vinpocetine is a white crystal powder that is odorless and tasteless. It is soluble in chloroform and ethanol, but insoluble in water.

How is Vinpocetine used in terms of its pharmacokinetics?

Vinpocetine is highly fat-soluble, easily absorbed by the body, and metabolized in the liver before being excreted by the kidneys.

What are the production methods for Vinpocetine?

Vinpocetine can be produced by synthesizing Vincamine extracted from plants like periwinkle and performing various chemical reactions to obtain the final product.

What are the pharmacological effects of Vinpocetine?

Vinpocetine inhibits calcium dependency phosphodiesterase activity, increases cAMP levels to relax vascular smooth muscle, enhances red blood cell deformation capacity, and promotes brain tissue metabolism.

What are the biological activities associated with Vinpocetine?

Vinpocetine acts as a phosphodiesterase inhibitor, selectively targeting PDE1, and can block voltage-gated Na+ channels. It also has anti-inflammatory and neuroprotective effects.

※ Please kindly note that our products are for research use only.