Viridiflorine

Catalog Number	ACM551575
CAS Number	551-57-5
Synonyms	(2S,3S)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aα)-hexahydro-1H-pyrrolizin-1-yl]methyl ester
Molecular Weight	285.38
InChI	InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11-,12-,13-,15-/m0/s1
InChI Key	BWQSLRZZOVFVHJ-ABHRYQDASA-N
Melting Point	102-103.5 °C
Purity	95%+
Complexity	360
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	285.19400834
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]([C@@](C(C)C)(C(=O)OC[C@@H]1CCN2[C@H]1CCC2)O)O
Monoisotopic Mass	285.19400834
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	70 Ų

Custom Q&A

What is the chemical name of the compound represented by Viridiflorine?

The chemical name is (2S,3S)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aα)-hexahydro-1H-pyrrolizin-1-yl]methyl ester.

What are some synonyms for the compound Viridiflorine?

Some synonyms are Viridiflorine, and Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, [(1R,7aS)-hexahydro-1H-pyrrolizin-1-yl]methyl ester, (2S,3S)-.

What is the CAS number of Viridiflorine?

The CAS number is 551-57-5.

What is the molecular formula of Viridiflorine?

The molecular formula is C15H27NO4.

What is the molecular weight of Viridiflorine?

The molecular weight is 285.38.

What is the melting point of Viridiflorine?

The melting point is 102-103.5°C.

In what types of solvents is Viridiflorine sparingly soluble?

It is sparingly soluble in Et20.

How is the methiodide of Viridiflorine prepared?

The methiodide is prepared as colorless crystals from aqueous MeOH, with a melting point of 142-4°C.

What are the products of alkaline hydrolysis of Viridiflorine?

The products are trachelanthamidine and viridifloric acid.

How was the most probable structure of Viridiflorine determined?

The most probable structure was determined based on chemical reactions and spectroscopic characteristics.

※ Please kindly note that our products are for research use only.