Virosine B

Catalog Number	ACM5008480
CAS Number	5008-48-0 / 1052228-70-2
Synonyms	Securinol A
Molecular Weight	235.28
InChI	InChI=1S/C13H17NO3/c15-10-7-13-8(6-12(16)17-13)5-9(10)14-4-2-1-3-11(13)14/h6,9-11,15H,1-5,7H2
InChI Key	SVHWKXNNRMAUAN-UHFFFAOYSA-N
Melting Point	135-136 °C
Purity	95%+
Complexity	419
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	235.1208434
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	235.1208434
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.8 Ų

Custom Q&A

What is the chemical formula of Virosine B?

The chemical formula of Virosine B is C13H17NO3.

What is the molecular weight of Virosine B?

VThe molecular weight of Virosine B is 235.28.

What are the synonyms for Virosine B?

The synonyms for Virosine B are Virosine B and (5R,10aR,10bS,12R)-4,5,8,9,10,10a-Hexahydro-12-hydroxy-7H-5,10b-ethano-2H-furo[2,3-a]quinolizin-2-one.

What is the boiling point of Virosine B?

The predicted boiling point of Virosine B is 491.8±45.0 °C.

What is the predicted density of Virosine B?

The predicted density of Virosine B is 1.37±0.1 g/cm3.

What is the predicted pka of Virosine B?

The predicted pka of Virosine B is 14.31±0.20.

What is the CAS number of Virosine B?

The CAS number of Virosine B is 1052228-70-2.

What is the chemical structure of Virosine B?

The chemical structure of Virosine B is (5R,10aR,10bS,12R)-4,5,8,9,10,10a-Hexahydro-12-hydroxy-7H-5,10b-ethano-2H-furo[2,3-a]quinolizin-2-one.

※ Please kindly note that our products are for research use only.