Voacamine

Catalog Number	ACM3371855
CAS Number	3371-85-5
Structure
Synonyms	Voacanginine
IUPAC Name	Methyl (1S,15S,17S,18S)-17-ethyl-6-[(1R,12R,14R,15E)-15-ethylidene-18-methoxycarbonyl-17-methyl-10,17-diazatetracyclo[12.3.1.03,11.04,9]octadeca-3(11),4,6,8-tetraen-12-yl]-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene-1-carboxylate
Molecular Weight	704.90
Molecular Formula	C43H52N4O5
Canonical SMILES	CCC1CC2CC3(C1N(C2)CCC4=C3NC5=CC(=C(C=C45)OC)C6CC7C(C(CC8=C6NC9=CC=CC=C89)N(CC7=CC)C)C(=O)OC)C(=O)OC
InChI	InChI=1S/C43H52N4O5/c1-7-24-15-23-20-43(42(49)52-6)39-27(13-14-47(21-23)40(24)43)29-19-36(50-4)30(17-34(29)45-39)31-16-28-25(8-2)22-46(3)35(37(28)41(48)51-5)18-32-26-11-9-10-12-33(26)44-38(31)32/h8-12,17,19,23-24,28,31,35,37,40,44-45H,7,13-16,18,20-22H2,1-6H3/b25-8-/t23-,24-,28-,31+,35+,37?,40-,43+/m0/s1
InChI Key	VCMIRXRRQJNZJT-XRMSBCOFSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	1410
Exact Mass	704.39377077
Heavy Atom Count	52
Isomeric SMILES	CC[C@H]1C[C@H]2C[C@@]3([C@H]1N(C2)CCC4=C3NC5=CC(=C(C=C45)OC)[C@H]6C[C@@H]\7C([C@@H](CC8=C6NC9=CC=CC=C89)N(C/C7=C/C)C)C(=O)OC)C(=O)OC
Monoisotopic Mass	704.39377077
Topological Polar Surface Area	99.9Ų

Custom Q&A

What is the chemical structure of voacamine?

The chemical structure of voacamine is methyl 12-methoxy-13-(17-methoxy-17-oxovobasan-3alpha-yl)ibogamine-18-carboxylate.

What are some synonyms for voacamine?

Some synonyms for voacamine are voacanginine, MMH 18, NSC 82591, and Ibogamine-18-carboxylic acid, among others.

What is the CAS number for voacamine?

The CAS number for voacamine is 3371-85-5.

What is the molecular formula of voacamine?

The molecular formula of voacamine is C43H52N4O5.

What is the molecular weight of voacamine?

The molecular weight of voacamine is 704.9.

What is the melting point of voacamine?

The melting point of voacamine is 223°C (dec.) when dissolved in methanol.

What is the specific rotation of voacamine in chloroform?

The specific rotation of voacamine in chloroform is alpha D20 -52°.

How should voacamine be stored?

Voacamine should be stored at -20°C.

In what solvents is voacamine soluble?

Voacamine is soluble in DMF (30 mg/ml), DMSO (20 mg/ml), and ethanol (5 mg/ml).

What is one known use of voacamine?

Voacamine has shown activity against Leishmania ultrastructure through poisoning the bi-subunit topoisomerase IB.

※ Please kindly note that our products are for research use only.