Voafinidine

Catalog Number	ACM180059772
CAS Number	180059-77-2
Synonyms	2H-3,7-Methanoazacycloundecino[5,4-b]indole-5,6-diol, 7-ethyl-1,4,5,6,7,8,9,10-octahydro-10-methyl-, (5S,6S,7S)- (9CI)
Molecular Weight	328.4
InChI	InChI=1S/C20H28N2O2/c1-3-20-10-8-17-15(14-6-4-5-7-16(14)21(17)2)9-11-22(13-20)12-18(23)19(20)24/h4-7,18-19,23-24H,3,8-13H2,1-2H3/t18-,19+,20-/m0/s1
InChI Key	LZWQFKGUQLBGKC-ZCNNSNEGSA-N
Purity	95%+
Complexity	459
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	328.21507814
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@]12CCC3=C(CCN(C1)C[C@@H]([C@H]2O)O)C4=CC=CC=C4N3C
Monoisotopic Mass	328.21507814
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	48.6 Ų

Custom Q&A

What is the chemical formula for Voafinidine?

The chemical formula for Voafinidine is C20H28N2O2.

What is the molecular weight of Voafinidine?

The molecular weight of Voafinidine is 328.45.

What is the CAS number for Voafinidine?

The CAS number for Voafinidine is 180059-77-2.

What are some synonyms for Voafinidine?

Some synonyms for Voafinidine are 2H-3,7-Methanoazacycloundecino[5,4-b]indole-5,6-diol, 7-ethyl-1,4,5,6,7,8,9,10-octahydro-10-methyl-, (5S,6S,7S)- (9CI).

What is the predicted boiling point of Voafinidine?

The predicted boiling point of Voafinidine is 526.9±39.0 °C.

What is the predicted density of Voafinidine?

The predicted density of Voafinidine is 1.26±0.1 g/cm3.

What is the predicted pka value of Voafinidine?

The predicted pka value of Voafinidine is 14.21±0.60.

What is the structure of Voafinidine?

The structure of Voafinidine is 2H-3,7-Methanoazacycloundecino[5,4-b]indole-5,6-diol, 7-ethyl-1,4,5,6,7,8,9,10-octahydro-10-methyl-, (5S,6S,7S)-.

※ Please kindly note that our products are for research use only.