Worenine

Worenine

Inquiry
Catalog Number ACM38763290
CAS Number 38763-29-0
Structure
Synonyms Berberine impurity 6
Molecular Weight 334.3
InChI InChI=1S/C20H16NO4/c1-11-14-6-18-17(23-10-24-18)5-13(14)8-21-3-2-12-4-16-19(25-9-22-16)7-15(12)20(11)21/h4-8H,2-3,9-10H2,1H3/q+1
InChI Key LCXREBMNASQAOC-UHFFFAOYSA-N
Purity 95%+
Complexity 530
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 334.10793299
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Monoisotopic Mass 334.10793299
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the synonym for Worenine?

Berberine Impurity 6; 5,6-Dihydro-14-methyl-bis[1,3]benzodioxolo[5,6-a:5',6'-g]quinolizinium; Worenin; Berberine Methyl

What is the CAS number for Worenine?

38763-29-0

What is the molecular formula of Worenine?

C20H16NO4+

What is the molecular weight of Worenine?

334.35

In what forms is Worenine soluble?

Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

In what form does Worenine exist?

Crystalline form

Where is Worenine naturally present?

Worenine is present in Cop tis japonica

How can Worenine iodide be obtained?

Worenine can be oxidized by iodine in EtOH to obtain worenine iodide

What is the usage of Worenine?

Worenine is used in a fluorophore switched probe which aids in correction of an abasic site (AP site) caused by the removal of a damaged base in DNA

How is Worenine classified in terms of chemical structure?

Worenine is classified as an alkaloid according to ChEBI.

※ Please kindly note that our products are for research use only.