Xanthiazone

Catalog Number	ACM212701978
CAS Number	212701-97-8
Structure
Synonyms	4,8-Dihydro-7-(hydroxymethyl)-8,8-dimethyl-2H-1,4-benzothiazine-3,5-dione
IUPAC Name	7-(Hydroxymethyl)-8,8-dimethyl-4H-1,4-benzothiazine-3,5-dione
Molecular Weight	239.29
Molecular Formula	C11H13NO3S
Canonical SMILES	CC1(C(=CC(=O)C2=C1SCC(=O)N2)CO)C
InChI	InChI=1S/C11H13NO3S/c1-11(2)6(4-13)3-7(14)9-10(11)16-5-8(15)12-9/h3,13H,4-5H2,1-2H3,(H,12,15)
InChI Key	DNLBWKAXMIGTSS-UHFFFAOYSA-N
Melting Point	159-161 °C
Purity	98%
Density	1.38±0.1 g/ml
Appearance	Powder
Complexity	435
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	239.06161445
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	239.06161445
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	91.7 Ų

Custom Q&A

What is the chemical formula for Xanthiazone?

The chemical formula for Xanthiazone is C11H13NO3S.

What is the molecular weight of Xanthiazone?

The molecular weight of Xanthiazone is 239.29.

What are some synonyms for Xanthiazone?

Some synonyms for Xanthiazone are 4,8-Dihydro-7-(hydroxymethyl)-8,8-dimethyl-2H-1,4-benzothiazine-3,5-dione and 2H-1,4-Benzothiazine-3,5-dione.

What is the melting point of Xanthiazone?

The melting point of Xanthiazone is 159-161℃ in methanol.

What is the boiling point of Xanthiazone?

The boiling point of Xanthiazone is 516.6±50.0 °C.

What is the density of Xanthiazone?

The density of Xanthiazone is 1.38±0.1 g/cm3 at 20 ºC and 760 Torr.

What is the pka value of Xanthiazone?

The pka value of Xanthiazone is 9.57±0.60.

Where is Xanthiazone isolated from?

Xanthiazone is isolated from the seeds of Xanthium strumarium.

What activity does Xanthiazone exhibit?

Xanthiazone exhibits anti-fungal activity.

What are some of the product categories that Xanthiazone falls under?

Xanthiazone falls under product categories such as chemical reagent, pharmaceutical intermediate, phytochemical, and standardized herbal extract.

※ Please kindly note that our products are for research use only.