Xanthoplanine

Catalog Number	ACM6872884
CAS Number	6872-88-4
Synonyms	(6aS)-1,2,10-Trimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-ium-9-ol
Molecular Weight	356.4
InChI	InChI=1S/C21H25NO4/c1-22(2)7-6-12-10-18(25-4)21(26-5)20-14-11-17(24-3)16(23)9-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/p+1/t15-/m0/s1
InChI Key	FGUCOPALAZXICJ-HNNXBMFYSA-O
Purity	90%+
Complexity	512
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	356.18618331
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)O)OC)OC)C
Monoisotopic Mass	356.18618331
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	47.9 Ų

Custom Q&A

What is the chemical name of Xanthoplanine?

The chemical name of Xanthoplanine is (S)-5,6,6a,7-Tetrahydro-9-hydroxy-1,2,10-trimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolin-6-ium.

What is the molecular formula of Xanthoplanine?

The molecular formula of Xanthoplanine is C21H26NO4+.

What is the molecular weight of Xanthoplanine?

The molecular weight of Xanthoplanine is 356.44.

In which plant is Xanthoplanine present?

Xanthoplanine is present in Xanthoxylum planisplium.

How is Xanthoplanine isolated?

Xanthoplanine is isolated as the iodide hemihydrate.

What is the melting point of Xanthoplanine?

The melting point of Xanthoplanine is 148-9°C (dec.).

What are the groups present in Xanthoplanine?

Xanthoplanine contains three methoxyl groups and a phenolic hydroxyl group.

How is the O-methyl ether of Xanthoplanine characterized?

The O-methyl ether of Xanthoplanine is characterized as the iodide.

What is the optical rotation of Xanthoplanine in MeOH?

The optical rotation of Xanthoplanine in MeOH is [α]21/sup>D + 71°.

What is the definition of Xanthoplanine according to ChEBI?

According to ChEBI, Xanthoplanine is an isoquinoline alkaloid.

※ Please kindly note that our products are for research use only.