Xylopine

Catalog Number	ACM517715
CAS Number	517-71-5
Synonyms	(7aR)-6,7,7a,8-Tetrahydro-10-methoxy-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline
Molecular Weight	295.3
InChI	InChI=1S/C18H17NO3/c1-20-12-2-3-13-11(6-12)7-14-16-10(4-5-19-14)8-15-18(17(13)16)22-9-21-15/h2-3,6,8,14,19H,4-5,7,9H2,1H3/t14-/m1/s1
InChI Key	RFWCCZDSXIZJMF-CQSZACIVSA-N
Melting Point	78-102 °C
Purity	95%+
Complexity	431
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	295.1208434
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5
Monoisotopic Mass	295.1208434
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	39.7 Ų

Custom Q&A

What is the chemical name of Xylopine?

Xylopine is also known as (7aR)-6,7,7a,8-Tetrahydro-10-methoxy-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline.

What are the synonyms of Xylopine?

The synonyms of Xylopine include Xylopine, 6Abeta-noraporphine, and 9-methoxy-1,2-(methylenedioxy)-.

What is the CAS number for Xylopine?

The CAS number for Xylopine is 517-71-5.

What is the molecular formula of Xylopine?

The molecular formula of Xylopine is C18H17NO3.

What is the molecular weight of Xylopine?

The molecular weight of Xylopine is 295.33.

What is the melting point of Xylopine?

The melting point of Xylopine is 78-102°C.

How should Xylopine be stored?

Xylopine should be stored at 4°C, away from moisture and light.

From which plant is Xylopine obtained?

Xylopine is an alkaloid obtained from Xylopia discreta.

What class of bases does Xylopine belong to?

Xylopine belongs to the noraporphine class of bases.

What is the chemical structure of Xylopine?

The chemical structure of Xylopine is that of O-methylanolobine, with one methoxyl group and one methylenedioxy group present.

※ Please kindly note that our products are for research use only.