Yunnandaphninine G

Catalog Number	ACM1042143838
CAS Number	1042143-83-8
Molecular Weight	469.7
InChI	InChI=1S/C30H47NO3/c1-18(2)20-9-13-26(3)19-8-15-29-12-6-7-22(29)30(26,24(20)31(29)17-19)16-10-21-27(4)14-11-23(32)28(21,5)25(33)34-27/h18-24,32H,6-17H2,1-5H3/t19-,20-,21+,22-,23+,24+,26+,27+,28+,29-,30+/m1/s1
InChI Key	RBVPIMQHYHLJGS-QXDVLWGXSA-N
Purity	95%+
Complexity	919
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	11
Exact Mass	469.35559436
Heavy Atom Count	34
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)[C@H]1CC[C@]2([C@@H]3CC[C@]45CCC[C@H]4[C@]2([C@H]1N5C3)CC[C@H]6[C@@]7(CC[C@@H]([C@]6(C(=O)O7)C)O)C)C
Monoisotopic Mass	469.35559436
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	49.8 Ų

Custom Q&A

What is the chemical name of Yunnandaphninine G?

The chemical name of Yunnandaphninine G is 6-Oxabicyclo[3.2.1]octan-7-one, 2-hydroxy-1,5-dimethyl-8-[2-[(3aR,4S,4aS,5R,8S,8aR,8bS,10S)-octahydro-8-methyl-5-(1-methylethyl)-4,8,3a-[1,2,4]butanetriylcyclopent[b]indol-8a(4aH)-yl]ethyl]-, (1S,2S,5S,8R)-.

What is the CAS number of Yunnandaphninine G?

The CAS number of Yunnandaphninine G is 1042143-83-8.

What is the molecular formula of Yunnandaphninine G?

The molecular formula of Yunnandaphninine G is C30H47NO3.

What is the molecular weight of Yunnandaphninine G?

The molecular weight of Yunnandaphninine G is 469.71.

What is the boiling point of Yunnandaphninine G?

The boiling point of Yunnandaphninine G is predicted to be 580.1±25.0 °C.

What is the density of Yunnandaphninine G?

The density of Yunnandaphninine G is predicted to be 1.17±0.1 g/cm3.

What is the pka value of Yunnandaphninine G?

The pka value of Yunnandaphninine G is predicted to be 14.50±0.70.

What are the synonyms of Yunnandaphninine G?

One of the synonyms of Yunnandaphninine G is Yunnandaphninine G.

※ Please kindly note that our products are for research use only.