Zanthobungeanine

Catalog Number	ACM64190949
CAS Number	64190-94-9
Synonyms	7-Methoxy-N-methylflindersine
Molecular Weight	271.31
InChI	InChI=1S/C16H17NO3/c1-16(2)9-8-11-14(20-16)10-6-5-7-12(19-4)13(10)17(3)15(11)18/h5-9H,1-4H3
InChI Key	SYNIFQKDJZQOLI-UHFFFAOYSA-N
Melting Point	56-58 °C
Purity	95%+
Complexity	492
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	271.1208434
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	271.1208434
PhysicalState	Solid
Rotatable Bond Count	1
Topological Polar Surface Area	38.8 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 64190-94-9?

The product name is Zanthobungeanine.

What are the synonyms of Zanthobungeanine?

The synonyms are Zanthobungeanine and 7-Methoxy-N-methylflindersine.

What is the chemical formula of Zanthobungeanine?

The chemical formula is C16H17NO3.

What is the molecular weight of Zanthobungeanine?

The molecular weight is 271.31 g/mol.

What is the melting point of Zanthobungeanine?

The melting point is 56-58℃ in ethyl ether.

What is the boiling point of Zanthobungeanine?

The boiling point is 409.3±45.0 °C (Predicted).

What is the density of Zanthobungeanine?

The density is 1.24±0.1 g/cm3 (Predicted).

What is the pka value of Zanthobungeanine?

The pka value is 1.48±0.40 (Predicted).

What is the molecular structure of Zanthobungeanine?

The molecular structure is 5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-7-methoxy-2,2,6-trimethyl-.

Based on the information provided, what can be predicted about the solubility of Zanthobungeanine?

Based on the data provided, it is not possible to predict the solubility of Zanthobungeanine.

※ Please kindly note that our products are for research use only.