1-Hydroxyacridone

Catalog Number	ACM65582549
CAS Number	65582-54-9
Molecular Weight	211.22
InChI	InChI=1S/C13H9NO2/c15-11-7-3-6-10-12(11)13(16)8-4-1-2-5-9(8)14-10/h1-7,15H,(H,14,16)
InChI Key	YZTFXTYKRHQLIU-UHFFFAOYSA-N
Purity	95%+
Complexity	292
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	211.06332853
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	211.06332853
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical name of 1-Hydroxyacridone?

The chemical name of 1-Hydroxyacridone is 1-Hydroxyacridin-9(10H)-one.

What are the synonyms of 1-Hydroxyacridone?

The synonyms of 1-Hydroxyacridone are 1-Hydroxyacridin-9(10H)-one and 1-Hydroxyacridone.

What is the molecular formula of 1-Hydroxyacridone?

The molecular formula of 1-Hydroxyacridone is C13H11NO2.

What is the molecular weight of 1-Hydroxyacridone?

The molecular weight of 1-Hydroxyacridone is 213.23194.

How many carbon atoms are present in the molecular formula of 1-Hydroxyacridone?

There are 13 carbon atoms present in the molecular formula of 1-Hydroxyacridone.

What is the significance of the chemical structure of 1-Hydroxyacridone?

The chemical structure of 1-Hydroxyacridone plays a crucial role in its biological and chemical properties.

Can 1-Hydroxyacridone be used in pharmaceutical applications?

Yes, 1-Hydroxyacridone can be used in pharmaceutical applications due to its unique properties.

What are the potential uses of 1-Hydroxyacridone in research or industry?

1-Hydroxyacridone can be used as a precursor in the synthesis of various organic compounds or as a fluorescent dye in biological studies.

Are there any known side effects or hazards associated with the use of 1-Hydroxyacridone?

It is important to always follow proper safety protocols when handling 1-Hydroxyacridone, as it may pose certain risks if not handled correctly.

※ Please kindly note that our products are for research use only.