1-Methyl-2-tridecylquinolin-4-one

1-Methyl-2-tridecylquinolin-4-one

Inquiry
Catalog Number ACM15266350
CAS Number 15266-35-0
Synonyms Dihydroevocarpine
Molecular Weight 341.5
InChI InChI=1S/C23H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-16-20-19-23(25)21-17-14-15-18-22(21)24(20)2/h14-15,17-19H,3-13,16H2,1-2H3
InChI Key DWHCRAGHDDLXEM-UHFFFAOYSA-N
Melting Point 68-69 °C
Purity 95%+
Complexity 414
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 341.27186474
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 0
Monoisotopic Mass 341.27186474
PhysicalState Powder
Rotatable Bond Count 12
Topological Polar Surface Area 20.3 Ų
Custom Q&A

What are some potential uses of 1-Methyl-2-tridecylquinolin-4-one?

Some potential uses of 1-Methyl-2-tridecylquinolin-4-one include as a target for P-gp, in antifection, and as a MAO.

What are some synonyms for 1-Methyl-2-tridecylquinolin-4-one?

Some synonyms for 1-Methyl-2-tridecylquinolin-4-one are Dihydroevocarpine and 1-methyl-2-tridecyl-4(1H)-quinolone.

What is the CAS number for 1-Methyl-2-tridecylquinolin-4-one?

The CAS number for 1-Methyl-2-tridecylquinolin-4-one is 15266-35-0.

What is the molecular formula of 1-Methyl-2-tridecylquinolin-4-one?

The molecular formula of 1-Methyl-2-tridecylquinolin-4-one is C23H35NO.

What is the molecular weight of 1-Methyl-2-tridecylquinolin-4-one?

The molecular weight of 1-Methyl-2-tridecylquinolin-4-one is 341.53.

At what temperature does 1-Methyl-2-tridecylquinolin-4-one melt?

1-Methyl-2-tridecylquinolin-4-one melts at 68-69℃.

In what solvents is 1-Methyl-2-tridecylquinolin-4-one soluble?

1-Methyl-2-tridecylquinolin-4-one is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of 1-Methyl-2-tridecylquinolin-4-one?

The predicted boiling point of 1-Methyl-2-tridecylquinolin-4-one is 447.0±45.0 °C.

What is the predicted density of 1-Methyl-2-tridecylquinolin-4-one?

The predicted density of 1-Methyl-2-tridecylquinolin-4-one is 0.964±0.06 g/cm3.

※ Please kindly note that our products are for research use only.