1-Pyrrolidinecarboxamide,2-oxo-(9CI)

Catalog Number	ACM40451670-1
CAS Number	40451-67-0
Structure
Synonyms	Squamolone
Molecular Weight	128.13
InChI	InChI=1S/C5H8N2O2/c6-5(9)7-3-1-2-4(7)8/h1-3H2,(H2,6,9)
InChI Key	XYVMBSCIEDOIJQ-UHFFFAOYSA-N
Melting Point	143-144 °C
Purity	95%+
Complexity	155
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	128.058577502
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	128.058577502
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	63.4 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 40451-67-0?

The chemical name is 1-Pyrrolidinecarboxamide,2-oxo-(9CI).

What are some synonyms for 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

Some synonyms include Squamolone and 1-Pyrrolidinecarboxamide, 2-oxo-.

What is the molecular formula of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The molecular formula is C5H8N2O2.

What is the molecular weight of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The molecular weight is 128.13 g/mol.

What is the product category of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The product category is AMIDE.

What is the melting point of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The melting point is 143-144 °C (Solv: benzene).

What is the predicted boiling point of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The predicted boiling point is 250.7±23.0 °C.

What is the predicted density of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The predicted density is 1.353±0.06 g/cm3.

What is the predicted pka value of 1-Pyrrolidinecarboxamide,2-oxo-(9CI)?

The predicted pka value is 13.82±0.20.

According to ChEBI, what is Squamolone classified as?

Squamolone is classified as a pyrrolidinecarboxamide.

※ Please kindly note that our products are for research use only.