10,11-Dimethoxy-17-epi-alpha-yohimbine

Catalog Number	ACM84667061
CAS Number	84667-06-1
Synonyms	10,11-Dimethoxy-α-yohimbine
Molecular Weight	414.5
InChI	InChI=1S/C23H30N2O5/c1-28-19-9-15-13-6-7-25-11-12-4-5-18(26)21(23(27)30-3)14(12)8-17(25)22(13)24-16(15)10-20(19)29-2/h9-10,12,14,17-18,21,24,26H,4-8,11H2,1-3H3/t12-,14+,17+,18-,21+/m1/s1
InChI Key	UYNXYVGVBSLXHE-RXZBFESWSA-N
Purity	95%+
Complexity	647
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	414.21547206
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	COC1=C(C=C2C(=C1)C3=C(N2)[C@@H]4C[C@H]5[C@H](CC[C@H]([C@H]5C(=O)OC)O)CN4CC3)OC
Monoisotopic Mass	414.21547206
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	84 Ų

Custom Q&A

What is the chemical formula of 10,11-DiMethoxy-α-yohimbine?

The chemical formula of 10,11-DiMethoxy-α-yohimbine is C23H30N2O5.

What are some synonyms for 10,11-DiMethoxy-α-yohimbine?

Some synonyms for 10,11-DiMethoxy-α-yohimbine include 10,11-DiMethoxy-17-epi-alpha-yohimbine and Yohimban-16-carboxylic acid, 17-hydroxy-10,11-dimethoxy-, methyl ester.

What is the CAS number for 10,11-DiMethoxy-α-yohimbine?

The CAS number for 10,11-DiMethoxy-α-yohimbine is 84667-06-1.

What is the molecular weight of 10,11-DiMethoxy-α-yohimbine?

The molecular weight of 10,11-DiMethoxy-α-yohimbine is 414.49.

What is the predicted boiling point of 10,11-DiMethoxy-α-yohimbine?

The predicted boiling point of 10,11-DiMethoxy-α-yohimbine is 587.4±50.0 °C.

What is the predicted density of 10,11-DiMethoxy-α-yohimbine at 20 ºC and 760 Torr?

The predicted density of 10,11-DiMethoxy-α-yohimbine is 1.32±0.1 g/cm3 at 20 ºC and 760 Torr.

What is the pka value of 10,11-DiMethoxy-α-yohimbine?

The pka value of 10,11-DiMethoxy-α-yohimbine is 14.39±0.40.

What are some physical properties of 10,11-DiMethoxy-α-yohimbine?

Some physical properties of 10,11-DiMethoxy-α-yohimbine include its boiling point, density, and predicted pka.

How is 10,11-DiMethoxy-α-yohimbine predicted to behave under certain conditions?

10,11-DiMethoxy-α-yohimbine is predicted to have a boiling point, density, and pka value under certain conditions.

※ Please kindly note that our products are for research use only.