10-Hydroxydihydroperaksine

Catalog Number	ACM451478470
CAS Number	451478-47-0
Synonyms	18-Norsarpagan-10,17,19-triol, 19,20-dihydro-21-methyl-, (20α,21β)-
IUPAC Name	13,15-bis(hydroxymethyl)-16-methyl-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraen-7-ol
Molecular Weight	328.41
Molecular Formula	C19H24N2O3
Canonical SMILES	CC1C(C2CC3N1C(C2CO)CC4=C3NC5=C4C=C(C=C5)O)CO
InChI	InChI=1S/C19H24N2O3/c1-9-14(7-22)11-5-18-19-13(6-17(21(9)18)15(11)8-23)12-4-10(24)2-3-16(12)20-19/h2-4,9,11,14-15,17-18,20,22-24H,5-8H2,1H3
InChI Key	LCWCFXWKNADLOU-UHFFFAOYSA-N
Purity	98%
Appearance	Solid
Complexity	503
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	328.17869263
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	4
Monoisotopic Mass	328.17869263
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	79.7 Ų

Custom Q&A

What is the chemical formula of 10-Hydroxydihydroperaksine?

The chemical formula of 10-Hydroxydihydroperaksine is C19H24N2O3.

What is the molecular weight of 10-Hydroxydihydroperaksine?

The molecular weight of 10-Hydroxydihydroperaksine is 328.41.

What is the CAS number of 10-Hydroxydihydroperaksine?

The CAS number of 10-Hydroxydihydroperaksine is 451478-47-0.

What is the predicted boiling point of 10-Hydroxydihydroperaksine?

The predicted boiling point of 10-Hydroxydihydroperaksine is 545.1±45.0 °C.

In what solvents is 10-Hydroxydihydroperaksine soluble?

10-Hydroxydihydroperaksine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, among others.

What is the predicted density of 10-Hydroxydihydroperaksine?

The predicted density of 10-Hydroxydihydroperaksine is 1.43±0.1 g/cm3.

In what form does 10-Hydroxydihydroperaksine exist?

10-Hydroxydihydroperaksine exists in the form of a powder.

What is the predicted pKa value of 10-Hydroxydihydroperaksine?

The predicted pKa value of 10-Hydroxydihydroperaksine is 10.25±0.70.

How is 10-Hydroxydihydroperaksine commonly used?

10-Hydroxydihydroperaksine is commonly used in research and pharmaceutical applications.

Are there any other synonyms for 10-Hydroxydihydroperaksine?

Yes, another synonym for 10-Hydroxydihydroperaksine is 18-Norsarpagan-10,17,19-triol, 19,20-dihydro-21-methyl-, (20α,21β)-.

※ Please kindly note that our products are for research use only.