10-Methoxycamptothecin

Catalog Number	ACM19685100
CAS Number	19685-10-0
Structure
Synonyms	(4S)-9-Methoxy-4α-ethyl-4β-hydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione
Molecular Weight	378.4
InChI	InChI=1S/C21H18N2O5/c1-3-21(26)15-8-17-18-12(6-11-7-13(27-2)4-5-16(11)22-18)9-23(17)19(24)14(15)10-28-20(21)25/h4-8,26H,3,9-10H2,1-2H3/t21-/m0/s1
InChI Key	KLFJSYOEEYWQMR-NRFANRHFSA-N
Melting Point	254-255 °C
Purity	95%+
Complexity	790
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	378.12157168
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=CC(=CC5=C4)OC)O
Monoisotopic Mass	378.12157168
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	89 Ų

Custom Q&A

What is the molecular formula of 10-Methoxycamptothecin?

The molecular formula of 10-Methoxycamptothecin is C21H18N2O5.

What is the molecular weight of 10-Methoxycamptothecin?

The molecular weight of 10-Methoxycamptothecin is 378.38.

What is the primary usage of 10-Methoxycamptothecin?

10-Methoxycamptothecin is primarily used in the treatment of cancers.

What class of compound does 10-Methoxycamptothecin belong to?

10-Methoxycamptothecin belongs to the Camptothecin derivative class of compounds.

Why is 10-Methoxycamptothecin used in the treatment of hyperproliferative diseases?

10-Methoxycamptothecin is used in the treatment of hyperproliferative diseases due to its anti-cancer properties.

How is 10-Methoxycamptothecin typically administered for cancer treatment?

10-Methoxycamptothecin is typically administered through intravenous injection for cancer treatment.

What is the mechanism of action of 10-Methoxycamptothecin in treating cancers?

The mechanism of action of 10-Methoxycamptothecin in treating cancers involves inhibiting DNA topoisomerase I.

※ Please kindly note that our products are for research use only.