14,15-Didehydroisoeburnamine

Catalog Number	ACM50838114
CAS Number	50838-11-4
Molecular Weight	294.4
InChI	InChI=1S/C19H22N2O/c1-2-19-9-5-10-20-11-8-14-13-6-3-4-7-15(13)21(16(22)12-19)17(14)18(19)20/h3-7,9,16,18,22H,2,8,10-12H2,1H3/t16-,18-,19+/m1/s1
InChI Key	HQEIVSZGVBPOQZ-QRQLOZEOSA-N
Purity	95%+
Complexity	492
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	294.17321333
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@]12C[C@H](N3C4=CC=CC=C4C5=C3[C@H]1N(CC5)CC=C2)O
Monoisotopic Mass	294.17321333
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	28.4 Ų

Custom Q&A

What is the chemical formula of 14,15-Didehydroisoeburnamine?

The chemical formula of 14,15-Didehydroisoeburnamine is C19H22N2O.

What is the molecular weight of 14,15-Didehydroisoeburnamine?

The molecular weight of 14,15-Didehydroisoeburnamine is 294.39.

What is the CAS number of 14,15-Didehydroisoeburnamine?

The CAS number of 14,15-Didehydroisoeburnamine is 50838-11-4.

What is the boiling point of 14,15-Didehydroisoeburnamine?

The predicted boiling point of 14,15-Didehydroisoeburnamine is 484.8±45.0 °C.

What is the density of 14,15-Didehydroisoeburnamine?

The predicted density of 14,15-Didehydroisoeburnamine is 1.34±0.1 g/cm3.

What is the predicted pKa value of 14,15-Didehydroisoeburnamine?

The predicted pKa value of 14,15-Didehydroisoeburnamine is 14.37±0.40.

What are the synonyms of 14,15-Didehydroisoeburnamine?

The synonyms of 14,15-Didehydroisoeburnamine include Eburnamenin-14-ol, 17,18-didehydro-14,15-dihydro-, and 1415-Didehydroisoeburnamine/1718-Didehydro-(-)-isoeburnamine.

What are the predicted properties of 14,15-Didehydroisoeburnamine?

The predicted properties of 14,15-Didehydroisoeburnamine include boiling point, density, and pKa.

How is 14,15-Didehydroisoeburnamine also known as?

14,15-Didehydroisoeburnamine is also known as Eburnamenin-14-ol, 17,18-didehydro-14,15-dihydro-, and 1415-Didehydroisoeburnamine/1718-Didehydro-(-)-isoeburnamine.

※ Please kindly note that our products are for research use only.