14-Acetylneoline

Catalog Number	ACM1354865
CAS Number	1354-86-5
Synonyms	14-O-Acetylneoline
Molecular Weight	479.61
InChI	InChI=1S/C10H9NO2/c12-6-10(13)8-5-11-9-4-2-1-3-7(8)9/h1-5,11-12H,6H2
InChI Key	IBLZDDPFMAFWKP-UHFFFAOYSA-N
Melting Point	98-202 °C
Purity	95%+
Complexity	205
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	175.06332853
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	175.06332853
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	53.1 Ų

Custom Q&A

What is the chemical name of 14-Acetylneoline?

The chemical name of 14-Acetylneoline is Aconitane-1,8,14-triol, 20-ethyl-6,16-dimethoxy-4-(methoxymethyl)-, 14-acetate.

What is the CAS number of 14-Acetylneoline?

The CAS number of 14-Acetylneoline is 1354-86-5.

What is the molecular formula of 14-Acetylneoline?

The molecular formula of 14-Acetylneoline is C26H41NO7.

What is the molecular weight of 14-Acetylneoline?

The molecular weight of 14-Acetylneoline is 479.61.

What is the melting point of 14-Acetylneoline?

The melting point of 14-Acetylneoline is 198-202 °C.

What is the predicted boiling point of 14-Acetylneoline?

The predicted boiling point of 14-Acetylneoline is 578.1±50.0 °C.

What is the predicted density of 14-Acetylneoline?

The predicted density of 14-Acetylneoline is 1.29±0.1 g/cm3.

What is the predicted pka of 14-Acetylneoline?

The predicted pka of 14-Acetylneoline is 13.11±0.70.

How many oxygen atoms are present in the molecular formula of 14-Acetylneoline?

There are 7 oxygen atoms present in the molecular formula of 14-Acetylneoline.

What is the chemical structure of 14-Acetylneoline?

The chemical structure of 14-Acetylneoline is shown as Aconitane-1,8,14-triol, 20-ethyl-6,16-dimethoxy-4-(methoxymethyl)-, 14-acetate.

※ Please kindly note that our products are for research use only.