14-Formyldihydrorutaecarpine

14-Formyldihydrorutaecarpine

Inquiry
Catalog Number ACM68353231
CAS Number 68353-23-1
Molecular Weight 318.4
InChI InChI=1S/C20H18N2O2/c23-11-16-12-5-1-2-7-15(12)20(24)22-10-9-14-13-6-3-4-8-17(13)21-18(14)19(16)22/h1-8,11,14,16,18-19,21H,9-10H2
InChI Key PFCOCSIZTVLBIJ-UHFFFAOYSA-N
Purity 95%+
Complexity 536
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 318.136827821
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 1
Monoisotopic Mass 318.136827821
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 49.4 Ų
Custom Q&A

What is the chemical formula for 14-Formyldihydrorutaecarpine?

The chemical formula for 14-Formyldihydrorutaecarpine is C19H15N3O2.

What is the molecular weight of 14-Formyldihydrorutaecarpine?

The molecular weight of 14-Formyldihydrorutaecarpine is 317.34.

What is the boiling point of 14-Formyldihydrorutaecarpine?

The boiling point of 14-Formyldihydrorutaecarpine is predicted to be 638.5±55.0 °C.

What is the predicted density of 14-Formyldihydrorutaecarpine?

The predicted density of 14-Formyldihydrorutaecarpine is 1.47±0.1 g/cm3.

What is the pKa value of 14-Formyldihydrorutaecarpine?

The pKa value of 14-Formyldihydrorutaecarpine is predicted to be 16.56±0.20.

Where is 14-Formyldihydrorutaecarpine found naturally?

14-Formyldihydrorutaecarpine is found in the ripe fruits of Evodia rutaecarpa.

What are the potential uses of 14-Formyldihydrorutaecarpine?

14-Formyldihydrorutaecarpine is a new alkaloid with potential antioxidant effects, shown through inhibition of oxygen radical formation via human neutrophils.

※ Please kindly note that our products are for research use only.