14-Norpseurotin A

Catalog Number	ACM1031727340
CAS Number	1031727-34-0
Molecular Weight	417.4
InChI	InChI=1S/C21H23NO8/c1-4-8-13(23)14(24)15-11(2)16(25)20(30-15)18(27)21(29-3,22-19(20)28)17(26)12-9-6-5-7-10-12/h4-10,13-14,18,23-24,27H,1-3H3,(H,22,28)/b8-4-/t13-,14-,18+,20+,21+/m0/s1
InChI Key	FCGCMRDADMTJIM-LFDIKFNASA-N
Purity	90%+
Complexity	799
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	417.14236669
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	4
Isomeric SMILES	C/C=C\[C@@H]([C@@H](C1=C(C(=O)[C@@]2(O1)[C@H]([C@@](NC2=O)(C(=O)C3=CC=CC=C3)OC)O)C)O)O
Monoisotopic Mass	417.14236669
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	142 Ų

Custom Q&A

What is the chemical formula of 14-Norpseurotin A?

The chemical formula of 14-Norpseurotin A is C21H23NO8.

What is the molecular weight of 14-Norpseurotin A?

The molecular weight of 14-Norpseurotin A is 417.41 g/mol.

What is the boiling point of 14-Norpseurotin A?

The boiling point of 14-Norpseurotin A is predicted to be 750.5±60.0 °C.

What is the density of 14-Norpseurotin A?

The density of 14-Norpseurotin A is predicted to be 1.44±0.1 g/cm3.

What is the pKa value of 14-Norpseurotin A?

The pKa value of 14-Norpseurotin A is predicted to be 14.76±0.20.

Where is 14-Norpseurotin A isolated from?

14-Norpseurotin A is isolated from Aspergillus sydowii.

What activities does 14-Norpseurotin A exhibit?

14-Norpseurotin A exhibits antibacterial, antileishmanial, and anticancer activities.

What role does 14-Norpseurotin A play?

14-Norpseurotin A plays a role as an antibacterial agent, an antineoplastic agent, an antileishmanial agent, and an Aspergillus metabolite.

What type of compound is 14-Norpseurotin A?

14-Norpseurotin A is an azaspiro compound, a lactam, an oxaspiro compound, a secondary alcohol, and an alkaloid.

How is 14-Norpseurotin A related to pseurotin A?

14-Norpseurotin A is functionally related to pseurotin A.

※ Please kindly note that our products are for research use only.