(16R)-Dihydrositsirikine

Catalog Number	ACM6519262
CAS Number	6519-26-2
Synonyms	18,19-Dihydro-16(R)-sitsirikine
Molecular Weight	356.5
InChI	InChI=1S/C21H28N2O3/c1-3-13-11-23-9-8-15-14-6-4-5-7-18(14)22-20(15)19(23)10-16(13)17(12-24)21(25)26-2/h4-7,13,16-17,19,22,24H,3,8-12H2,1-2H3/t13-,16-,17-,19-/m0/s1
InChI Key	UHOKSUGCIDKRQZ-UHEFJODHSA-N
Purity	95%+
Complexity	514
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	356.20999276
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@H]1CN2CCC3=C([C@@H]2C[C@@H]1[C@H](CO)C(=O)OC)NC4=CC=CC=C34
Monoisotopic Mass	356.20999276
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	65.6 Ų

Custom Q&A

What is the chemical formula of (16R)-Dihydrositsirikine?

The chemical formula of (16R)-Dihydrositsirikine is C21H28N2O3.

What is the molecular weight of (16R)-Dihydrositsirikine?

The molecular weight of (16R)-Dihydrositsirikine is 356.47.

What is the CAS number of (16R)-Dihydrositsirikine?

The CAS number of (16R)-Dihydrositsirikine is 6519-26-2.

What is the predicted boiling point of (16R)-Dihydrositsirikine?

The predicted boiling point of (16R)-Dihydrositsirikine is 547.5±45.0 °C.

What is the predicted pka value of (16R)-Dihydrositsirikine?

The predicted pka value of (16R)-Dihydrositsirikine is 14.30±0.10.

What is the predicted density of (16R)-Dihydrositsirikine?

The predicted density of (16R)-Dihydrositsirikine is 1.24±0.1 g/cm3.

What is the melting point of (16R)-Dihydrositsirikine?

The melting point of (16R)-Dihydrositsirikine is 215 °C.

What are the synonyms of (16R)-Dihydrositsirikine?

The synonyms of (16R)-Dihydrositsirikine are 18,19-Dihydro-16(R)-sitsirikine and Indolo[2,3-a]quinolizine-2-acetic acid, 3-ethyl-1,2,3,4,6,7,12,12b-octahydro-α-(hydroxymethyl)-, methyl ester, (αR,2S,3R,12bS)-.

What is the common name of the chemical compound with CAS number 6519-26-2?

The common name of the chemical compound with CAS number 6519-26-2 is (16R)-Dihydrositsirikine.

※ Please kindly note that our products are for research use only.