18-Beta-hydroxy-3-epi-alpha-yohimbine

Catalog Number	ACM81703062
CAS Number	81703-06-2
Molecular Weight	370.4
InChI	InChI=1S/C21H26N2O4/c1-27-21(26)18-14-9-16-19-13(12-4-2-3-5-15(12)22-19)6-7-23(16)10-11(14)8-17(24)20(18)25/h2-5,11,14,16-18,20,22,24-25H,6-10H2,1H3/t11-,14+,16-,17-,18+,20+/m1/s1
InChI Key	MMVZFQGCDSDHSV-DOGZXOHNSA-N
Purity	95%+
Complexity	587
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	370.18925731
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	3
Isomeric SMILES	COC(=O)[C@H]1[C@H]2C[C@@H]3C4=C(CCN3C[C@H]2C[C@H]([C@@H]1O)O)C5=CC=CC=C5N4
Monoisotopic Mass	370.18925731
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	85.8 Ų

Custom Q&A

What is the chemical name of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The chemical name of 18-Beta-hydroxy-3-epi-alpha-yohimbine is Yohimban-16-carboxylic acid, 17,18-dihydroxy-, methyl ester, (3β,16β,17α,18β,20α)-.

What is the CAS number of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The CAS number of 18-Beta-hydroxy-3-epi-alpha-yohimbine is 81703-06-2.

What is the molecular formula of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The molecular formula of 18-Beta-hydroxy-3-epi-alpha-yohimbine is C21H26N2O4.

What is the molecular weight of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The molecular weight of 18-Beta-hydroxy-3-epi-alpha-yohimbine is 370.44214.

What is the boiling point of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The boiling point of 18-Beta-hydroxy-3-epi-alpha-yohimbine is 564.0±50.0 °C (Predicted).

In which solvents is 18-Beta-hydroxy-3-epi-alpha-yohimbine soluble?

18-Beta-hydroxy-3-epi-alpha-yohimbine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

18-Beta-hydroxy-3-epi-alpha-yohimbine is in powder form.

What is the predicted pKa of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The predicted pKa of 18-Beta-hydroxy-3-epi-alpha-yohimbine is 13.88±0.60.

What are the physical chemical properties of 18-Beta-hydroxy-3-epi-alpha-yohimbine?

The physical chemical properties of 18-Beta-hydroxy-3-epi-alpha-yohimbine include its boiling point, density, solubility, form, and pKa.

How can 18-Beta-hydroxy-3-epi-alpha-yohimbine be used in research or industrial applications?

18-Beta-hydroxy-3-epi-alpha-yohimbine can be used in research or industrial applications as a chemical compound with specific properties and solubility in various solvents.

※ Please kindly note that our products are for research use only.