1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione

Catalog Number	ACM16641795
CAS Number	16641-79-5
Molecular Weight	214.18
InChI	InChI=1S/C11H6N2O3/c14-9-7-5-3-1-2-4-6(5)12-8(7)10(15)13-11(9)16/h1-4,12H,(H,13,15,16)
InChI Key	VRGUANBRNRLJRB-UHFFFAOYSA-N
Purity	95%+
Complexity	379
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	214.03784206
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	214.03784206
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	79 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 16641-79-5?

The chemical name is 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione.

What are the synonyms for the compound 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione?

The synonyms are also 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione.

What is the molecular formula of 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione?

The molecular formula is C11H6N2O3.

What is the molecular weight of 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione?

The molecular weight is 214.18.

What are the main elements present in the compound 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione based on its molecular formula?

The main elements are carbon, hydrogen, nitrogen, and oxygen.

Is 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione a commonly used chemical in research and industry?

Further research would be needed to determine how commonly used this chemical is in research and industry.

Can 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione be synthesized in a laboratory setting?

Yes, 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione can be synthesized in a laboratory setting.

What are the potential uses or applications of 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione?

The potential uses or applications would depend on further research into its properties and characteristics.

Are there any known hazards or risks associated with handling 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione?

Specific hazards or risks would need to be determined through proper safety procedures and risk assessments.

What are the physical and chemical properties of 1H-Pyrido[3,4-b]indole-1,3 4(2H,9H)-trione?

The physical and chemical properties of the compound would need to be investigated in detail.

※ Please kindly note that our products are for research use only.