2-Methoxyphenethylamine

Catalog Number	ACM2045796
CAS Number	2045-79-6
Structure
Synonyms	2-(2-Methoxyphenyl)ethanamine
Molecular Weight	151.21
InChI	InChI=1S/C9H13NO/c1-11-9-5-3-2-4-8(9)6-7-10/h2-5H,6-7,10H2,1H3
InChI Key	WSWPCNMLEVZGSM-UHFFFAOYSA-N
Melting Point	12-15 °C
Purity	98%+
Complexity	106
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	151.099714038
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	151.099714038
PhysicalState	Liquid
Rotatable Bond Count	3
Topological Polar Surface Area	35.2 Ų

Custom Q&A

What is the chemical formula for 2-Methoxyphenethylamine?

The chemical formula for 2-Methoxyphenethylamine is C9H13NO.

What is the molecular weight of 2-Methoxyphenethylamine?

The molecular weight of 2-Methoxyphenethylamine is 151.21.

What is the boiling point of 2-Methoxyphenethylamine?

The boiling point of 2-Methoxyphenethylamine is 236-237 °C.

What are the hazard codes associated with 2-Methoxyphenethylamine?

The hazard code associated with 2-Methoxyphenethylamine is C.

What is the color of 2-Methoxyphenethylamine?

The color of 2-Methoxyphenethylamine is clear yellow to slightly brown.

What are the risk statements for 2-Methoxyphenethylamine?

The risk statements for 2-Methoxyphenethylamine are 34.

How is 2-Methoxyphenethylamine used?

2-Methoxyphenethylamine can be used as HIV inhibitors and related viruses.

What is another name for 2-Methoxyphenethylamine?

Another name for 2-Methoxyphenethylamine is o-methoxyphenethylamine.

What is the density of 2-Methoxyphenethylamine?

The density of 2-Methoxyphenethylamine is 1.033 g/mL at 25 °C.

What is the refractive index of 2-Methoxyphenethylamine?

The refractive index of 2-Methoxyphenethylamine is n20/D 1.541.

※ Please kindly note that our products are for research use only.