3,6-Ditigloyloxynortropane

Catalog Number	ACM359723709
CAS Number	359723-70-9
Synonyms	2-Butenoic acid, 2-methyl-, (1R,3S,5S,6R)-8-azabicyclo[3.2.1]octane-3,6-diyl ester, (2E,2'E)-rel- (9CI)
Molecular Weight	307.4
InChI	InChI=1S/C17H25NO4/c1-5-10(3)16(19)21-13-7-12-8-15(14(9-13)18-12)22-17(20)11(4)6-2/h5-6,12-15,18H,7-9H2,1-4H3/b10-5+,11-6+
InChI Key	KNKLFOLFJCUPIN-YOYBCKCWSA-N
Purity	95%+
Complexity	509
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	307.17835828
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(\C)/C(=O)OC1CC2CC(C(C1)N2)OC(=O)/C(=C/C)/C
Monoisotopic Mass	307.17835828
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	64.6 Ų

Custom Q&A

What is the chemical name of the compound referred to as 3,6-Ditigloyloxynortropane?

The chemical name is 2-Butenoic acid, 2-methyl-, (1R,3S,5S,6R)-8-azabicyclo[3.2.1]octane-3,6-diyl ester, (2E,2'E)-rel-

What is the CAS number for 3,6-Ditigloyloxynortropane?

The CAS number is 359723-70-9

What is the molecular formula of 3,6-Ditigloyloxynortropane?

The molecular formula is C17H25NO4

What is the molecular weight of 3,6-Ditigloyloxynortropane?

The molecular weight is 307.39

What is the predicted boiling point of 3,6-Ditigloyloxynortropane?

The predicted boiling point is 400.8±45.0 °C

What is the predicted density of 3,6-Ditigloyloxynortropane?

The predicted density is 1.12±0.1 g/cm3

What is the predicted pKa value of 3,6-Ditigloyloxynortropane?

The predicted pKa value is 7.81±0.60

What are the synonyms of 3,6-Ditigloyloxynortropane?

The synonyms are 3,6-Ditigloyloxynortropane and (2E,2'E)-rel-

※ Please kindly note that our products are for research use only.