(3R)-2,3-Dihydro-3-hydroxypyrrolo[2,1-b]quinazolin-9(1H)-one

Catalog Number	ACM486646
CAS Number	486-64-6
Synonyms	l-Vasicinone
Molecular Weight	202.21
InChI	InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2/t9-/m0/s1
InChI Key	SDIVYZXRQHWCKF-VIFPVBQESA-N
Melting Point	200-202 °C
Purity	95%+
Complexity	327
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	202.074227566
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1CN2C(=NC3=CC=CC=C3C2=O)[C@H]1O
Monoisotopic Mass	202.074227566
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	52.9 Ų

Custom Q&A

What is the chemical formula of VASICINONE?

The chemical formula of VASICINONE is C11H10N2O2.

What is the molecular weight of VASICINONE?

The molecular weight of VASICINONE is 202.21.

What is the melting point of VASICINONE?

The melting point of VASICINONE is 200-202℃.

In what solvents is VASICINONE soluble?

VASICINONE is soluble in chloroform and ethanol.

What is the refractive index of VASICINONE?

The refractive index of VASICINONE is 1.5300.

What is the boiling point of VASICINONE estimated to be?

The boiling point of VASICINONE is estimated to be 320.7°C.

From which plants is VASICINONE derived?

VASICINONE is present in Adhatoda vasica and Peganum harmala.

What is the specific rotation of VASICINONE?

The specific rotation of VASICINONE is [α]22D -100°.

What is the primary usage of VASICINONE as?

VASICINONE is an active bronchodilator.

What is the target enzyme affected by VASICINONE?

VASICINONE targets P450, specifically CYP17.

※ Please kindly note that our products are for research use only.