4-(Dimethylamino)cinnamic acid

Catalog Number	ACM1552961
CAS Number	1552-96-1
Structure
Synonyms	N,N-dimethyl amine cinnamic acid
Molecular Weight	191.23
Molecular Formula	C11H13NO2
InChI	InChI=1S/C11H13NO2/c1-12(2)10-6-3-9(4-7-10)5-8-11(13)14/h3-8H,1-2H3,(H,13,14)/b8-5+
InChI Key	CQNPVMCASGWEHM-VMPITWQZSA-N
Melting Point	227-228 °C
Purity	95%+
Complexity	215
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	191.094628657
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN(C)C1=CC=C(C=C1)/C=C/C(=O)O
Monoisotopic Mass	191.094628657
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the molecular formula of 4-(Dimethylamino)cinnamic acid?

The molecular formula is C11H13NO2.

What is the molecular weight of 4-(Dimethylamino)cinnamic acid?

The molecular weight is 191.23 g/mol.

What is the melting point of 4-(Dimethylamino)cinnamic acid?

The melting point is 227-228 °C (dec.).

In what form is 4-(Dimethylamino)cinnamic acid commonly found?

It is commonly found as a crystalline powder.

What is the solubility of 4-(Dimethylamino)cinnamic acid?

It is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

How can 4-(Dimethylamino)cinnamic acid be purified?

It can be recrystallized from ethanol.

What color is 4-(Dimethylamino)cinnamic acid?

It is yellow to beige in color.

What are the hazard codes associated with 4-(Dimethylamino)cinnamic acid?

The hazard code is Xi.

How is 4-(Dimethylamino)cinnamic acid typically used?

It is used as a chemical substance in various synthesis processes.

What are some of the product categories that 4-(Dimethylamino)cinnamic acid falls under?

It falls under categories such as Cinnamic acid, Aromatic Cinnamic Acids, Esters and Derivatives, Peptide Synthesis, and Unnatural Amino Acid Derivatives.

※ Please kindly note that our products are for research use only.