4-Dimethylaminocinnamaldehyde

Catalog Number	ACM6203185-1
CAS Number	6203-18-5
Synonyms	3-(4-(Dimethylamino)phenyl)-2-propenal
Molecular Weight	175.23
InChI	InChI=1S/C11H13NO/c1-12(2)11-7-5-10(6-8-11)4-3-9-13/h3-9H,1-2H3/b4-3+
InChI Key	RUKJCCIJLIMGEP-ONEGZZNKSA-N
Melting Point	138-140 °C
Purity	95%+
Complexity	179
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	175.099714038
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN(C)C1=CC=C(C=C1)/C=C/C=O
Monoisotopic Mass	175.099714038
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical name of the compound 4-(Dimethylamino)cinnamaldehyde?

The chemical name of the compound is 4-(Dimethylamino)cinnamaldehyde.

What is the molecular formula of 4-(Dimethylamino)cinnamaldehyde?

The molecular formula is C11H13NO.

What is the melting point of 4-(Dimethylamino)cinnamaldehyde?

The melting point is 138-140°C.

What is the boiling point of 4-(Dimethylamino)cinnamaldehyde?

The boiling point is estimated to be 306.53°C.

What is the color of 4-(Dimethylamino)cinnamaldehyde?

The color is yellow to orange.

What is the main usage of 4-(Dimethylamino)cinnamaldehyde?

It is used as a reagent for the assay of indole product of apotryptophanase and tryptophanase, and in quantifying proanthocyanidines in cranberry powder.

How is 4-(Dimethylamino)cinnamaldehyde purified?

The aldehyde can be crystallized from ethanol or ligroin and dried in vacuo.

What is the hazard code associated with 4-(Dimethylamino)cinnamaldehyde?

The hazard code is Xi.

What is the storage temperature recommended for 4-(Dimethylamino)cinnamaldehyde?

The recommended storage temperature is -20°C.

How is 4-(Dimethylamino)cinnamaldehyde used in biochemistry?

It is used as a selective staining reagent to identify flavanols by staining them blue in color.

※ Please kindly note that our products are for research use only.