6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine

6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine

Inquiry
Catalog Number ACM2101836455
CAS Number 2101836-45-5
Molecular Weight 367.4
InChI InChI=1S/C21H21NO5/c1-24-16-9-13-7-15-19-12(5-6-22(15)11-23)8-18(26-3)21(27-4)20(19)14(13)10-17(16)25-2/h7-11H,5-6H2,1-4H3
InChI Key BZNWDTCCJWAIIP-UHFFFAOYSA-N
Purity 95%+
Complexity 531
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 367.14197277
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 367.14197277
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical name of the compound with the CAS number 2101836-45-5?

The chemical name of the compound is 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine.

What are some synonyms for 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine?

Some synonyms include 6H-Dibenzo[de,g]quinoline-6-carboxaldehyde, 4,5-dihydro-1,2,9,10-tetramethoxy-.

What is the molecular formula of 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine?

The molecular formula is C21H21NO5.

What is the molecular weight of the compound?

The molecular weight is 367.4.

What is the boiling point of 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine?

The boiling point is predicted to be 590.2±50.0 °C.

What is the density of the compound?

The density is predicted to be 1.310±0.06 g/cm3.

What is the pka value of 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine?

The pka value is 0.27±0.20.

What is the structure of the compound in terms of the arrangement of atoms?

The compound has a structure with a formyl group, four methoxy groups, and a dehydroaporphine ring.

What are some potential uses of 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine?

It may be used in research for its chemical properties or potential pharmaceutical applications.

What other information is important to know about 6-Formyl-1,2,9,10-tetramethoxy-6a,7-dehydroaporphine?

Additional information could include its synthesis, stability, reactivity, and any known biological effects.

※ Please kindly note that our products are for research use only.