7,8-Dihydroxy-4'-methoxyisoflavone

Catalog Number	ACM480864
CAS Number	480-86-4
Synonyms	8-Hydroxyformononetin
Molecular Weight	311.37
Molecular Formula	C16H12O5
InChI	InChI=1S/C16H25NO5/c1-9-10(2)16(3,20)15(19)21-8-11-4-6-17-7-5-12(13(11)17)22-14(9)18/h9-13,20H,4-8H2,1-3H3/t9-,10+,11+,12-,13-,16-/m1/s1
InChI Key	GXAPLLMJHZBIPX-VZYPABODSA-N
Purity	95%+
Complexity	481
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	311.1732729
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1[C@@H]([C@@](C(=O)OC[C@@H]2CCN3[C@H]2[C@@H](CC3)OC1=O)(C)O)C
Monoisotopic Mass	311.1732729
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical name of the compound with the synonym 8'-HYDROXYFORMONONETIN?

The chemical name of the compound is 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE.

What is the molecular formula of 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

The molecular formula is C16H25NO5.

What is the molecular weight of 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

The molecular weight is 311.37 g/mol.

What is the CAS number of 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

The CAS number is 480-86-4.

What are some other synonyms for 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

Other synonyms include RETUSIN, RETUSINE, and Aids071726.

What is the chemical structure of 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

The chemical structure is a 4H-1-Benzopyran-4-one with 2-(3,4-dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-.

What are some potential applications or uses of 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

It may have potential uses in research, pharmaceuticals, or cosmetics.

Are there any known side effects or risks associated with 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE?

It is always recommended to consult with a healthcare professional before using any new compound.

How is 7,8-DIHYDROXY-4'-METHOXYISOFLAVONE typically obtained or synthesized?

The compound may be obtained through synthesis in a laboratory setting.

※ Please kindly note that our products are for research use only.