7-Methoxy-beta-carboline-1-propionic acid

Catalog Number	ACM137756139
CAS Number	137756-13-9
Structure
Molecular Weight	270.28
InChI	InChI=1S/C15H14N2O3/c1-20-9-2-3-10-11-6-7-16-12(4-5-14(18)19)15(11)17-13(10)8-9/h2-3,6-8,17H,4-5H2,1H3,(H,18,19)
InChI Key	WEBVBZDGWMAXEF-UHFFFAOYSA-N
Purity	95%+
Complexity	363
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	270.10044231
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	270.10044231
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	75.2 Ų

Custom Q&A

What is the predicted density of 7-Methoxy-beta-carboline-1-propionic acid?

The predicted density of 7-Methoxy-beta-carboline-1-propionic acid is 1.370±0.06 g/cm3.

What are the synonyms of 7-Methoxy-beta-carboline-1-propionic acid?

The synonyms of 7-Methoxy-beta-carboline-1-propionic acid are 7-Methoxy-beta-carboline-1-propionic acid and 9H-Pyrido[3,4-b]indole-1-propanoic acid, 7-methoxy-.

What is the CAS number of 7-Methoxy-beta-carboline-1-propionic acid?

The CAS number of 7-Methoxy-beta-carboline-1-propionic acid is 137756-13-9.

What is the molecular formula of 7-Methoxy-beta-carboline-1-propionic acid?

The molecular formula of 7-Methoxy-beta-carboline-1-propionic acid is C15H14N2O3.

What is the molecular weight of 7-Methoxy-beta-carboline-1-propionic acid?

The molecular weight of 7-Methoxy-beta-carboline-1-propionic acid is 270.28.

What is the boiling point of 7-Methoxy-beta-carboline-1-propionic acid?

The boiling point of 7-Methoxy-beta-carboline-1-propionic acid is predicted to be 540.8±45.0 °C.

What is the density of 7-Methoxy-beta-carboline-1-propionic acid?

The density of 7-Methoxy-beta-carboline-1-propionic acid is predicted to be 1.370±0.06 g/cm3.

What is the pka value of 7-Methoxy-beta-carboline-1-propionic acid?

The pka value of 7-Methoxy-beta-carboline-1-propionic acid is predicted to be 3.90±0.10.

What is the predicted boiling point of 7-Methoxy-beta-carboline-1-propionic acid?

The predicted boiling point of 7-Methoxy-beta-carboline-1-propionic acid is 540.8±45.0 °C.

※ Please kindly note that our products are for research use only.