3,7a-Diepialexine

3,7a-Diepialexine

Inquiry
Catalog Number ACM119065826
CAS Number 119065-82-6
Structure
Description 3,7a-diepialexine is a natural product that can be found in plants. It has been shown to inhibit the glycosidases and vinyl ethers that are involved in the synthesis of polyhydroxylated compounds. 3,7a-diepialexine also inhibits the hydroxymethylation of chiral molecules and epoxidation reactions. This compound has been shown to have an inhibitory effect on human liver cells by binding to the protein cytochrome P450, thereby inhibiting oxygenation reactions.
Synonyms (+)-3-Epiaustraline
Molecular Weight 189.21 g/mol
Molecular Formula C8H15NO4
Canonical SMILES C1CN2[C@H]([C@H]([C@@H]([C@H]2[C@H]1O)O)O)CO
MDL Number MFCD00898251
Custom Q&A

What is the chemical name of 3,7a-Diepialexine?

The chemical name of 3,7a-Diepialexine is 1H-Pyrrolizine-1,2,7-triol, hexahydro-3-(hydroxymethyl)-, (1R,2R,3S,7S,7aR)-.

What is the CAS number for 3,7a-Diepialexine?

The CAS number for 3,7a-Diepialexine is 119065-82-6.

What is the molecular formula of 3,7a-Diepialexine?

The molecular formula of 3,7a-Diepialexine is C8H15NO4.

What is the molecular weight of 3,7a-Diepialexine?

The molecular weight of 3,7a-Diepialexine is 189.21 g/mol.

What is the predicted boiling point of 3,7a-Diepialexine?

The predicted boiling point of 3,7a-Diepialexine is 417.4±28.0 °C.

What is the predicted density of 3,7a-Diepialexine?

The predicted density of 3,7a-Diepialexine is 1.53±0.1 g/cm3.

What is the predicted pka value of 3,7a-Diepialexine?

The predicted pka value of 3,7a-Diepialexine is 13.80±0.70.

What are some synonyms for 3,7a-Diepialexine?

Some synonyms for 3,7a-Diepialexine include 3,7a-Diepialexine and hexahydro-3-(hydroxymethyl)-.

※ Please kindly note that our products are for research use only.