8,9-Dihydroxy-1,5,6,10B-tetrahydropyrrolo[2,1-A]isoquinolin-3(2H)-one

Catalog Number	ACM1021950797
CAS Number	1021950-79-7
Synonyms	Oleracein E
Molecular Weight	219.24
InChI	InChI=1S/C12H13NO3/c14-10-5-7-3-4-13-9(1-2-12(13)16)8(7)6-11(10)15/h5-6,9,14-15H,1-4H2
InChI Key	LJIDRFNRDLYHNC-UHFFFAOYSA-N
Purity	95%+
Complexity	307
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	219.08954328
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	219.08954328
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	60.8 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 1021950-79-7?

The chemical name of the compound is 8,9-Dihydroxy-1,5,6,10B-tetrahydropyrrolo[2,1-A]isoquinolin-3(2H)-one.

What are some synonyms for 8,9-Dihydroxy-1,5,6,10B-tetrahydropyrrolo[2,1-A]isoquinolin-3(2H)-one?

Some synonyms mentioned are Trolline, Oleracein E, and Pyrrolo[2,1-a]isoquinolin-3(2H)-one.

What is the molecular formula of 8,9-Dihydroxy-1,5,6,10B-tetrahydropyrrolo[2,1-A]isoquinolin-3(2H)-one?

The molecular formula is C12H13NO3.

What is the molecular weight of 8,9-Dihydroxy-1,5,6,10B-tetrahydropyrrolo[2,1-A]isoquinolin-3(2H)-one?

The molecular weight is 219.24 g/mol.

What is the main usage of Oleracein E?

Oleracein E is mentioned to possess potent antioxidant activity.

How did pretreatment with OE affect rotenone-treated SH-SY5Y human neuroblastoma cells?

Pretreatment with OE decreased lactic acid dehydrogenase (LDH) release and the apoptosis rate in the cells.

What effect did OE have on reactive oxygen species (ROS) levels in the cells?

OE reduced ROS levels in the cells.

What signaling pathway did OE inhibit in the mechanistic study?

OE inhibited extracellular signal-regulated kinase (ERK) 1/2 phosphorylation.

How did OE prevent cytochrome C release in the cells?

OE prevented cytochrome C release by reducing the up-regulation of the proapoptotic protein Bax.

What is the role of OE in caspase-3 activation according to the reference?

OE prevented caspase-3 activation in the cells.

※ Please kindly note that our products are for research use only.