8-Acetonyldihydronitidine

8-Acetonyldihydronitidine

Inquiry
Catalog Number ACM80330398
CAS Number 80330-39-8
Structure
Synonyms 1-(2,3-Dimethoxy-12-methyl-13~{H}-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propan-2-one
Molecular Weight 405.4
InChI InChI=1S/C24H23NO5/c1-13(26)7-19-18-11-21(28-4)20(27-3)10-17(18)15-6-5-14-8-22-23(30-12-29-22)9-16(14)24(15)25(19)2/h5-6,8-11,19H,7,12H2,1-4H3
InChI Key OLYNXAXGZUKQDD-UHFFFAOYSA-N
Purity 95%+
Complexity 643
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 405.15762283
Heavy Atom Count 30
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 405.15762283
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical name of the compound 8-acetonyldihydronitidine?

The chemical name of the compound is 1-(12,13-Dihydro-2,3-dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)-2-propanone.

What are some synonyms for 8-acetonyldihydronitidine?

Some synonyms for 8-acetonyldihydronitidine are 6-Acetonyldihydronitidine, 2-Propanone, and 1-(2,3-dimethoxy-12-methyl-13~{H}-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)-.

What is the CAS number for 8-acetonyldihydronitidine?

The CAS number for 8-acetonyldihydronitidine is 80330-39-8.

What is the molecular formula of 8-acetonyldihydronitidine?

The molecular formula of 8-acetonyldihydronitidine is C24H23NO5.

What is the molecular weight of 8-acetonyldihydronitidine?

The molecular weight of 8-acetonyldihydronitidine is 405.44.

What functional groups are present in the molecule of 8-acetonyldihydronitidine?

The molecule contains a ketone group (propanone) and a phenanthridinyl group.

What are the potential research areas or fields that may be interested in studying 8-acetonyldihydronitidine?

Research areas such as pharmacology, organic chemistry, medicinal chemistry, and drug development may be interested in studying the compound for its potential biological activities or therapeutic properties.

※ Please kindly note that our products are for research use only.