8-Chlorotheophylline

Catalog Number	ACM85187
CAS Number	85-18-7
Structure
Synonyms	1,3-Dimethyl-8-chloroxanthine
Molecular Weight	214.61
Molecular Formula	C7H7ClN4O2
InChI	InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10)
InChI Key	RYIGNEOBDRVTHA-UHFFFAOYSA-N
Melting Point	290 °C
Purity	98%+
Complexity	297
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	214.0257532
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	214.0257532
PhysicalState	Solid
Rotatable Bond Count	0
Topological Polar Surface Area	69.3 Ų

Custom Q&A

What is the chemical formula of 8-Chlorotheophylline?

The chemical formula of 8-Chlorotheophylline is C7H7ClN4O2.

What is the CAS number for 8-Chlorotheophylline?

The CAS number for 8-Chlorotheophylline is 85-18-7.

What is the melting point of 8-Chlorotheophylline?

The melting point of 8-Chlorotheophylline is 290 °C.

How is 8-Chlorotheophylline stored?

8-Chlorotheophylline is stored in an inert atmosphere at temperatures between 2-8°C.

What is the solubility of 8-Chlorotheophylline?

8-Chlorotheophylline is slightly soluble in water.

What is the Hazard Class of 8-Chlorotheophylline?

The Hazard Class of 8-Chlorotheophylline is 6.1(b).

What is the color of 8-Chlorotheophylline?

8-Chlorotheophylline is white to off-white in color.

How is 8-Chlorotheophylline commonly used?

8-Chlorotheophylline is used as a stimulant drug and as a binding agent to form stable salts of pharmaceutical drugs.

What is the definition of 8-Chlorotheophylline according to ChEBI?

According to ChEBI, 8-Chlorotheophylline is 1,3-Dimethylxanthine in which the hydrogen at position 8 is substituted by chlorine.

How can 8-Chlorotheophylline be purified?

8-Chlorotheophylline can be purified by crystallization from water or ethanol.

※ Please kindly note that our products are for research use only.