8-Oxocoptisine

8-Oxocoptisine

Inquiry
Catalog Number ACM19716611
CAS Number 19716-61-1
Molecular Weight 335.3
InChI InChI=1S/C19H13NO5/c21-19-17-11(1-2-14-18(17)25-9-22-14)5-13-12-7-16-15(23-8-24-16)6-10(12)3-4-20(13)19/h1-2,5-7H,3-4,8-9H2
InChI Key UCAFJBSQKXVPDX-UHFFFAOYSA-N
Melting Point 283-285 °C
Purity 95%+
Complexity 621
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 335.07937252
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 335.07937252
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical formula of 8-Oxocoptisine?

The chemical formula of 8-Oxocoptisine is C19H13NO5.

What is the molecular weight of 8-Oxocoptisine?

The molecular weight of 8-Oxocoptisine is 335.31.

What is the melting point of 8-Oxocoptisine?

The melting point of 8-Oxocoptisine is 283-285℃.

In what form does 8-Oxocoptisine exist?

8-Oxocoptisine exists in the form of Cryst.

What is the solubility of 8-Oxocoptisine?

8-Oxocoptisine is soluble in Chloroform.

What are the safety precautions associated with 8-Oxocoptisine?

8-Oxocoptisine is considered a poison by ingestion and emits toxic vapors of NOx when heated to decomposition.

What is the predicted boiling point of 8-Oxocoptisine?

The predicted boiling point of 8-Oxocoptisine is 617.5±55.0 °C.

What is the storage temperature recommended for 8-Oxocoptisine?

The recommended storage temperature for 8-Oxocoptisine is -20°C.

How is 8-Oxocoptisine classified in terms of safety profile?

8-Oxocoptisine is classified as a poison by ingestion.

What is the toxicity information available for 8-Oxocoptisine?

The TDLo (lowest dose reported to cause toxic effects) for oral administration in rats is 1 mg/kg according to BIPBU* 24,1277,2001.

※ Please kindly note that our products are for research use only.