Acetylanonamine

Acetylanonamine

Inquiry
Catalog Number ACM138079626
CAS Number 138079-62-6
Synonyms 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 4-[2-(acetyloxy)ethylidene]-7-hydroxy-6,7,14-trimethyl-, [1R-(1R*,4E,6R*,7R*)]- (9CI)
Molecular Weight 423.5
InChI InChI=1S/C21H29NO8/c1-13-11-15(7-10-28-14(2)23)19(25)30-17-6-9-22(4)8-5-16(18(17)24)12-29-20(26)21(13,3)27/h5,7,13,17,27H,6,8-12H2,1-4H3/b15-7+,16-5-/t13-,17-,21-/m1/s1
InChI Key VSDQPXFTDJVJID-BCPVGGSJSA-N
Purity 95%+
Complexity 771
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 3
Exact Mass 423.18931688
Heavy Atom Count 30
Hydrogen Bond Acceptor Count 9
Hydrogen Bond Donor Count 1
Isomeric SMILES C[C@@H]1C/C(=C\COC(=O)C)/C(=O)O[C@@H]2CCN(C/C=C(\C2=O)/COC(=O)[C@]1(C)O)C
Monoisotopic Mass 423.18931688
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 119 Ų
Custom Q&A

What is the chemical name of acetylanonamine?

The chemical name of acetylanonamine is 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 4-[2-(acetyloxy)ethylidene]-7-hydroxy-6,7,14-trimethyl-, [1R-(1R*,4E,6R*,7R*)]-.

What is the CAS number for acetylanonamine?

The CAS number for acetylanonamine is 138079-62-6.

What is the molecular formula of acetylanonamine?

The molecular formula of acetylanonamine is C21H29NO8.

What is the molecular weight of acetylanonamine?

The molecular weight of acetylanonamine is 423.46.

What are some synonyms for acetylanonamine?

Some synonyms for acetylanonamine include acetylanonamine and 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 4-[2-(acetyloxy)ethylidene]-7-hydroxy-6,7,14-trimethyl-, [1R-(1R*,4E,6R*,7R*)]-.

What is the chemical structure of acetylanonamine?

The chemical structure of acetylanonamine is a complex tricyclic molecule with multiple functional groups.

What is the significance of the [1R-(1R*,4E,6R*,7R*)]- designation in the chemical name of acetylanonamine?

The [1R-(1R*,4E,6R*,7R*)]- designation refers to the stereochemistry of the molecule, specifying the arrangement of substituents around the chiral centers.

How does the stereochemistry of acetylanonamine affect its biological activity?

The stereochemistry of acetylanonamine can significantly impact its bioactivity, as specific orientations of functional groups are often required for optimal binding interactions with biological targets.

What are some potential applications of acetylanonamine in the pharmaceutical industry?

Acetylanonamine may have potential applications in drug discovery and development, particularly in the design of novel therapeutic agents targeting specific biological pathways or molecular targets.

※ Please kindly note that our products are for research use only.