Adenosine

Adenosine

Inquiry
Catalog Number ACM58617-2
CAS Number 58-61-7
Structure
Synonyms Adenocard
IUPAC Name (2R,3R,4S,5R)-2-(6-Aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
Molecular Weight 267.24
Molecular Formula C10H13N5O4
Canonical SMILES C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)O)N
InChI InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1
InChI Key OIRDTQYFTABQOQ-KQYNXXCUSA-N
Purity 98%+(HPLC)
Storage Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity 335
Exact Mass 267.09675391
Heavy Atom Count 19
Isomeric SMILES C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N
Monoisotopic Mass 267.09675391
Topological Polar Surface Area 140Ų
Custom Q&A

What is the chemical formula of Adenosine?

Adenosine has the chemical formula C10H13N5O4.

What is the melting point of Adenosine?

The melting point of Adenosine is 234-236 °C.

What are the medical uses of Adenosine?

Adenosine is used in the treatment of angina, hypertension, cerebrovascular disorders, and more. It is also given intravenously for supraventricular tachycardia.

How does Adenosine function in the body?

Adenosine helps in cellular energy transfer by forming molecules like ATP and ADP. It also plays a role in signaling pathways by forming cAMP.

What are the side effects of Adenosine?

Side effects of Adenosine include flushing, headache, chest discomfort, bronchoconstriction, and hypotension.

What is the mechanism of action of Adenosine?

Adenosine activates G protein-coupled potassium channels by binding to adenosine receptors, leading to membrane hyperpolarization and decreasing automaticity in the atrium and AV node.

How is Adenosine used in clinical practice?

Adenosine is used for the rapid termination of supraventricular arrhythmias following rapid bolus dosing.

What are the safety statements for Adenosine?

The safety statements for Adenosine include avoiding contact with eyes, skin, and clothing.

What is the biological function of Adenosine in the brain?

Adenosine regulates physiological and pathophysiological processes in the brain, including neuronal plasticity, learning and memory, and motor function.

What are the drug interactions of Adenosine?

Adenosine metabolism is slowed by dipyridamole, and methylxanthines can antagonize its effects through blockade of adenosine receptors.

※ Please kindly note that our products are for research use only.