Ajmaline

Catalog Number	ACM4360127
CAS Number	4360-12-7
Description	anti-arrhythmic agent
Molecular Weight	326.43 g/mol
Molecular Formula	C20H26N2O2
Canonical SMILES	CC[C@H]1C2CC3C4N(C)c5ccccc5C46CC(C2[C@@H]6O)N3[C@@H]1O
Storage	store at <-15℃, close container well
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939799090 - China: 2939799099
MDL Number	MFCD00135652

Custom Q&A

What are some synonyms for Ajmaline according to the reference?

AJMALAN-17,21-DIOL,(17R,21)-; AJMALINE; 21-diol,(17r,21-alpha)-ajmalan-1; Ajmalan-17,20-diol; Ajmalan-17,21-diol; Ajmalan-17,21-diol, (17R,21alpha)-; Ajmalin

What is the molecular formula of Ajmaline?

C20H26N2O2

What is the melting point of Ajmaline?

189°C

What is the hazard class of Ajmaline?

6.1(b)

What is the main therapeutic function of Ajmaline?

Antiarrhythmic

How is Ajmaline primarily used in clinical settings?

For treating atrial or ventricular extrasystoles, paroxysmal supraventricular or ventricular tachycardia, and paroxysmal atrial fibrillation

What is the targeted channel for Ajmaline's pharmacological effects?

Potassium Channel

What are some of the side effects associated with Ajmaline?

Disturbances of the central nervous system and intrahepatic cholestasis

What are some of the physical properties of Ajmaline?

White or yellowish crystal powder, well soluble in organic solvents, slightly soluble in water

How is Ajmaline typically stored?

At a temperature of 2-8°C

※ Please kindly note that our products are for research use only.