Alkaloid B

Catalog Number	ACM50656876
CAS Number	50656-87-6
Synonyms	8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-2-(phenylmethyl)-, acetate (ester), (1S,2R,3S,5R)- (9CI)
Molecular Weight	273.37
InChI	InChI=1S/C17H23NO2/c1-12(19)20-17-11-14-8-9-16(18(14)2)15(17)10-13-6-4-3-5-7-13/h3-7,14-17H,8-11H2,1-2H3/t14-,15-,16+,17+/m0/s1
InChI Key	OGPKDZFHCUWZQQ-MWDXBVQZSA-N
Purity	95%+
Complexity	351
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	273.172878976
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC(=O)O[C@@H]1C[C@@H]2CC[C@H]([C@@H]1CC3=CC=CC=C3)N2C
Monoisotopic Mass	273.172878976
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the common name for the compound with CAS number 50656-87-6?

The common name for the compound is Alkaloid B.

What are some synonyms for Alkaloid B?

Some synonyms for Alkaloid B include 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-2-(phenylmethyl)-, acetate (ester), (1S,2R,3S,5R)- (9CI).

What is the molecular formula of Alkaloid B?

The molecular formula of Alkaloid B is C17H23NO2.

What is the molecular weight of Alkaloid B?

The molecular weight of Alkaloid B is 273.37.

. What is the chemical classification of Alkaloid B?

Alkaloid B is classified as an alkaloid compound.

What is the stereochemistry of Alkaloid B?

The stereochemistry of Alkaloid B is listed as (1S,2R,3S,5R).

※ Please kindly note that our products are for research use only.